1,2-Benzenediol, 5-[4-(acetyloxy)tetrahydro-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2H-pyran-2-yl]-3-methoxy-, (2alpha,4alpha,6alpha)-(-)-
Internal ID | 55ab6fe2-a4da-46a1-8e40-ee0fa6d78fcb |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | [(2S,4R,6S)-2-(3,4-dihydroxy-5-methoxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC(OC(C1)C2=CC(=C(C(=C2)OC)O)O)CCC3=CC(=C(C=C3)O)OC |
SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@@H](O[C@@H](C1)C2=CC(=C(C(=C2)OC)O)O)CCC3=CC(=C(C=C3)O)OC |
InChI | InChI=1S/C23H28O8/c1-13(24)30-17-11-16(6-4-14-5-7-18(25)21(8-14)28-2)31-20(12-17)15-9-19(26)23(27)22(10-15)29-3/h5,7-10,16-17,20,25-27H,4,6,11-12H2,1-3H3/t16-,17+,20-/m0/s1 |
InChI Key | PCHXAHPLKORHMW-QKLQHJQFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H28O8 |
Molecular Weight | 432.50 g/mol |
Exact Mass | 432.17841785 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 3.30 |
1,2-Benzenediol, 5-[4-(acetyloxy)tetrahydro-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2H-pyran-2-yl]-3-methoxy-, (2alpha,4alpha,6alpha)-(-)- |
182227-92-5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.41% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.39% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.40% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.39% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.81% | 92.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.24% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 91.17% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.49% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.33% | 96.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.74% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.13% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.55% | 94.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.52% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.07% | 91.19% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.41% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.44% | 89.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.42% | 92.68% |
CHEMBL3194 | P02766 | Transthyretin | 81.39% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.98% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.19% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 101998843 |
LOTUS | LTS0171340 |
wikiData | Q105205749 |