1-[10-Hydroxy-4,5-bis(4-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethyl]-8-methoxy-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]chromen-7-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one
Internal ID | 0fcbe0c8-3b5b-47bf-87c2-a5e99f27d859 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 1-[10-hydroxy-4,5-bis(4-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethyl]-8-methoxy-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]chromen-7-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | COC1=C(C2=C(C3CC(OC(C3C(O2)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O)CCC6=CC=C(C=C6)O)C(=C1)O)C(=O)C=CC7=CC=C(C=C7)O |
SMILES (Isomeric) | COC1=C(C2=C(C3CC(OC(C3C(O2)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O)CCC6=CC=C(C=C6)O)C(=C1)O)C(=O)C=CC7=CC=C(C=C7)O |
InChI | InChI=1S/C42H38O9/c1-49-36-23-35(48)37-33-22-32(20-6-24-2-12-28(43)13-3-24)50-40(26-8-16-30(45)17-9-26)38(33)41(27-10-18-31(46)19-11-27)51-42(37)39(36)34(47)21-7-25-4-14-29(44)15-5-25/h2-5,7-19,21,23,32-33,38,40-41,43-46,48H,6,20,22H2,1H3 |
InChI Key | UJEBJUQQVRWYAG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H38O9 |
Molecular Weight | 686.70 g/mol |
Exact Mass | 686.25158279 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 7.40 |
There are no found synonyms. |
![2D Structure of 1-[10-Hydroxy-4,5-bis(4-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethyl]-8-methoxy-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]chromen-7-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one 2D Structure of 1-[10-Hydroxy-4,5-bis(4-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethyl]-8-methoxy-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]chromen-7-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/ae6262b0-86bf-11ee-a581-0f69c01f0e0b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.48% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.44% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.24% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.68% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 94.23% | 96.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.04% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.61% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 92.46% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.32% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.66% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.27% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.19% | 95.50% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 89.08% | 97.64% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.55% | 93.99% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.61% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.60% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.77% | 92.62% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.91% | 97.21% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.72% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.60% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 83.12% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.41% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.25% | 100.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.83% | 91.71% |
CHEMBL2535 | P11166 | Glucose transporter | 80.72% | 98.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.62% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.50% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia roxburghii |
PubChem | 73091984 |
LOTUS | LTS0135199 |
wikiData | Q105273890 |