[(1R,4R,4aS,5S,6S,8aR)-5-hydroxy-6-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl] (2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate
Internal ID | 2b19c5ca-51d1-484d-9dbc-a2ba5e90f820 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [(1R,4R,4aS,5S,6S,8aR)-5-hydroxy-6-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl] (2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate |
SMILES (Canonical) | CC12CCC(C(C1C(CCC2OC(=O)C(CC3=CC=C(C=C3)O)O)COC4C(C(C(C(O4)CO)O)O)O)O)C(=C)C(=O)OC |
SMILES (Isomeric) | C[C@@]12CC[C@H]([C@@H]([C@H]1[C@@H](CC[C@H]2OC(=O)[C@@H](CC3=CC=C(C=C3)O)O)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)C(=C)C(=O)OC |
InChI | InChI=1S/C31H44O13/c1-15(28(39)41-3)19-10-11-31(2)22(44-29(40)20(34)12-16-4-7-18(33)8-5-16)9-6-17(23(31)24(19)35)14-42-30-27(38)26(37)25(36)21(13-32)43-30/h4-5,7-8,17,19-27,30,32-38H,1,6,9-14H2,2-3H3/t17-,19-,20+,21+,22+,23+,24-,25+,26-,27+,30+,31-/m0/s1 |
InChI Key | CHYGFGCTCNTFCJ-BYJQNIQNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H44O13 |
Molecular Weight | 624.70 g/mol |
Exact Mass | 624.27819145 g/mol |
Topological Polar Surface Area (TPSA) | 213.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.61% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 98.16% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.67% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.65% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.43% | 95.89% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.32% | 83.82% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.19% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 88.89% | 85.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.35% | 91.19% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.72% | 92.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.57% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.52% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.52% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.19% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.97% | 94.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.66% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.58% | 94.73% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.13% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.29% | 86.33% |
CHEMBL268 | P43235 | Cathepsin K | 82.27% | 96.85% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.16% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.26% | 92.62% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.64% | 94.33% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.44% | 96.90% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.20% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ixeris repens |
PubChem | 163027644 |
LOTUS | LTS0172319 |
wikiData | Q104959487 |