Adrenoglomerulotropin
Internal ID | 6110e139-5c1a-42dc-ba6e-bebf442806fd |
Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
IUPAC Name | 6-methoxy-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
SMILES (Canonical) | CC1C2=C(CCN1)C3=C(N2)C=CC(=C3)OC |
SMILES (Isomeric) | CC1C2=C(CCN1)C3=C(N2)C=CC(=C3)OC |
InChI | InChI=1S/C13H16N2O/c1-8-13-10(5-6-14-8)11-7-9(16-2)3-4-12(11)15-13/h3-4,7-8,14-15H,5-6H2,1-2H3 |
InChI Key | RDUORFDQRFHYBF-UHFFFAOYSA-N |
Popularity | 11 references in papers |
Molecular Formula | C13H16N2O |
Molecular Weight | 216.28 g/mol |
Exact Mass | 216.126263138 g/mol |
Topological Polar Surface Area (TPSA) | 37.00 Ų |
XlogP | 1.90 |
1210-56-6 |
MMTC |
6-methoxy-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
1-Methyl-6-methoxy-1,2,3,4-tetrahydro-beta-carboline |
6-Methoxytetrahydroharman |
6-MEO-THH |
1-Methyl-6-methoxy-1,2,3,4-tetrahydro-2-carboline |
CHEMBL221811 |
U18P8J9O2I |
6-Methoxy-1,2,3,4-tetrahydroharman |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1833 | P41595 | Serotonin 2b (5-HT2b) receptor |
491 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.22% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.32% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.06% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.88% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.48% | 92.94% |
CHEMBL2535 | P11166 | Glucose transporter | 91.62% | 98.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.58% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.82% | 95.56% |
CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 87.39% | 96.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.09% | 95.89% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.70% | 93.31% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.34% | 93.99% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.24% | 90.00% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.12% | 88.48% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.56% | 94.00% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 82.38% | 98.59% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 81.18% | 90.71% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.14% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllodium pulchellum |
PubChem | 71028 |
LOTUS | LTS0056688 |
wikiData | Q4057960 |