Adian-5-ene
Internal ID | 34419ec6-2914-4012-adc2-96ecc053e766 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives |
IUPAC Name | (3R,3aR,5aR,11bR,13aS)-3a,5a,8,8,11b,13a-hexamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,9,10,11,11a,12,13,13b-tetradecahydrocyclopenta[a]chrysene |
SMILES (Canonical) | CC(C)C1CCC2C1(CCC3(C2(CCC4(C3CC=C5C4CCCC5(C)C)C)C)C)C |
SMILES (Isomeric) | CC(C)[C@H]1CCC2[C@@]1(CC[C@]3([C@]2(CC[C@@]4(C3CC=C5C4CCCC5(C)C)C)C)C)C |
InChI | InChI=1S/C30H50/c1-20(2)21-11-13-24-27(21,5)16-18-30(8)25-14-12-22-23(10-9-15-26(22,3)4)28(25,6)17-19-29(24,30)7/h12,20-21,23-25H,9-11,13-19H2,1-8H3/t21-,23?,24?,25?,27-,28+,29+,30-/m1/s1 |
InChI Key | WZDKBHGEBSMIQO-GYGSZJQCSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H50 |
Molecular Weight | 410.70 g/mol |
Exact Mass | 410.391251595 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 10.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.05% | 97.25% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.41% | 82.69% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.90% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.81% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.45% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.26% | 97.09% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.95% | 99.18% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.76% | 96.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.17% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 88.16% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.89% | 96.77% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.50% | 95.89% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 86.10% | 92.51% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.30% | 96.61% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.77% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.17% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.45% | 93.56% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.42% | 95.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.38% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adiantum capillus-veneris |
Oleandra wallichii |
PubChem | 15558361 |
LOTUS | LTS0057756 |
wikiData | Q104385889 |