[(2S,8S,10R,11S,12R,20R)-2-hydroxy-11,12-dimethyl-5,14-dioxo-6,18-dioxapentacyclo[10.7.1.04,8.08,20.015,19]icosa-3,15(19),16-trien-10-yl] acetate
Internal ID | 3e4d2636-72f4-465f-96a3-f9f6fd081a29 |
Taxonomy | Organoheterocyclic compounds > Cycloheptafurans |
IUPAC Name | [(2S,8S,10R,11S,12R,20R)-2-hydroxy-11,12-dimethyl-5,14-dioxo-6,18-dioxapentacyclo[10.7.1.04,8.08,20.015,19]icosa-3,15(19),16-trien-10-yl] acetate |
SMILES (Canonical) | CC1C(CC23COC(=O)C2=CC(C4C3C1(CC(=O)C5=C4OC=C5)C)O)OC(=O)C |
SMILES (Isomeric) | C[C@@H]1[C@@H](C[C@@]23COC(=O)C2=C[C@@H](C4[C@@H]3[C@]1(CC(=O)C5=C4OC=C5)C)O)OC(=O)C |
InChI | InChI=1S/C22H24O7/c1-10-16(29-11(2)23)8-22-9-28-20(26)13(22)6-14(24)17-18-12(4-5-27-18)15(25)7-21(10,3)19(17)22/h4-6,10,14,16-17,19,24H,7-9H2,1-3H3/t10-,14+,16-,17?,19-,21+,22-/m1/s1 |
InChI Key | FQUMVFNLVHRMPL-WAXMDMFJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O7 |
Molecular Weight | 400.40 g/mol |
Exact Mass | 400.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 103.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of [(2S,8S,10R,11S,12R,20R)-2-hydroxy-11,12-dimethyl-5,14-dioxo-6,18-dioxapentacyclo[10.7.1.04,8.08,20.015,19]icosa-3,15(19),16-trien-10-yl] acetate 2D Structure of [(2S,8S,10R,11S,12R,20R)-2-hydroxy-11,12-dimethyl-5,14-dioxo-6,18-dioxapentacyclo[10.7.1.04,8.08,20.015,19]icosa-3,15(19),16-trien-10-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ad92d1a0-8569-11ee-8ad5-1d7b06ee0f85.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.76% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.26% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.16% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.51% | 99.23% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.87% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.84% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.64% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.63% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.30% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.84% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.70% | 82.69% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.69% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.54% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.20% | 93.04% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.12% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.54% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.53% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia urolepis |
Salvia xalapensis |
PubChem | 13994530 |
LOTUS | LTS0140387 |
wikiData | Q104999895 |