17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
Internal ID | bc5e6f07-cf54-4181-8120-ddb65e7ad9f5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Ergostane steroids > Ergosterols and derivatives |
IUPAC Name | 17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2C=CC4C3(CCC(C4)O)C)C |
SMILES (Isomeric) | CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2C=CC4C3(CCC(C4)O)C)C |
InChI | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18-26,29H,11-17H2,1-6H3 |
InChI Key | IPIXCZHMKYKJNA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H46O |
Molecular Weight | 398.70 g/mol |
Exact Mass | 398.354866087 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 8.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.81% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.37% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.37% | 97.25% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.58% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.47% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.43% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.73% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.56% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.78% | 95.89% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.58% | 95.58% |
CHEMBL2581 | P07339 | Cathepsin D | 85.95% | 98.95% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.87% | 99.18% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.45% | 95.56% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.11% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.72% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.53% | 97.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.33% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.68% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.10% | 93.56% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 80.52% | 88.81% |
CHEMBL4072 | P07858 | Cathepsin B | 80.35% | 93.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Etlingera elatior |
PubChem | 77708066 |
LOTUS | LTS0005395 |
wikiData | Q105117269 |