(1S,2'S,5aR,7aR,8R,9S,11aR,11bR)-1-acetyloxy-9-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-5,5,7a,9,11b-pentamethyl-3,7-dioxospiro[2,5a,6,10,11,11a-hexahydro-1H-naphtho[2,1-c]oxepine-8,3'-oxirane]-2'-carboxylic acid
Internal ID | a92d2a66-7e74-40d2-88a6-e230b038f43c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | (1S,2'S,5aR,7aR,8R,9S,11aR,11bR)-1-acetyloxy-9-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-5,5,7a,9,11b-pentamethyl-3,7-dioxospiro[2,5a,6,10,11,11a-hexahydro-1H-naphtho[2,1-c]oxepine-8,3'-oxirane]-2'-carboxylic acid |
SMILES (Canonical) | CC(=O)OC1CC(=O)OC(C2C1(C3CCC(C4(C3(C(=O)C2)C)C(O4)C(=O)O)(C)C(C5=COC=C5)OC6C(C(C(C(O6)CO)O)O)O)C)(C)C |
SMILES (Isomeric) | CC(=O)O[C@H]1CC(=O)OC([C@H]2[C@]1([C@H]3CC[C@@]([C@@]4([C@@]3(C(=O)C2)C)[C@H](O4)C(=O)O)(C)[C@H](C5=COC=C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)(C)C |
InChI | InChI=1S/C34H46O15/c1-15(36)45-21-12-22(38)48-30(2,3)19-11-20(37)33(6)18(32(19,21)5)7-9-31(4,34(33)27(49-34)28(42)43)26(16-8-10-44-14-16)47-29-25(41)24(40)23(39)17(13-35)46-29/h8,10,14,17-19,21,23-27,29,35,39-41H,7,9,11-13H2,1-6H3,(H,42,43)/t17-,18-,19+,21+,23-,24+,25-,26+,27-,29+,31+,32-,33+,34-/m1/s1 |
InChI Key | GIVMXHQLQAIYEX-ANSWNMHUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H46O15 |
Molecular Weight | 694.70 g/mol |
Exact Mass | 694.28367076 g/mol |
Topological Polar Surface Area (TPSA) | 232.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
![2D Structure of (1S,2'S,5aR,7aR,8R,9S,11aR,11bR)-1-acetyloxy-9-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-5,5,7a,9,11b-pentamethyl-3,7-dioxospiro[2,5a,6,10,11,11a-hexahydro-1H-naphtho[2,1-c]oxepine-8,3'-oxirane]-2'-carboxylic acid 2D Structure of (1S,2'S,5aR,7aR,8R,9S,11aR,11bR)-1-acetyloxy-9-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-5,5,7a,9,11b-pentamethyl-3,7-dioxospiro[2,5a,6,10,11,11a-hexahydro-1H-naphtho[2,1-c]oxepine-8,3'-oxirane]-2'-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/ad57d250-862e-11ee-818a-73a976a6960c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.20% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.00% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 97.60% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.82% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.94% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.73% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.36% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.25% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.96% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.94% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.52% | 90.17% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.95% | 95.83% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.58% | 83.82% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.07% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.93% | 97.50% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.49% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.34% | 96.00% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.22% | 92.97% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.54% | 93.04% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.55% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus × aurantium |
PubChem | 162872861 |
LOTUS | LTS0083250 |
wikiData | Q105009237 |