(1S,2R,5R,8S,9R,10R,11S,15R,16S,18S)-9,10,15,16,18-pentahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one
Internal ID | 2d9d3638-e6eb-4fe5-840e-e78e68628c88 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | (1S,2R,5R,8S,9R,10R,11S,15R,16S,18S)-9,10,15,16,18-pentahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one |
SMILES (Canonical) | CC1(CCC(C23C1C(C(C45C2CCC(C4O)C(=C)C5=O)(OC3O)O)O)O)C |
SMILES (Isomeric) | CC1(CC[C@H]([C@@]23[C@H]1[C@H]([C@@]([C@@]45[C@@H]2CC[C@@H]([C@@H]4O)C(=C)C5=O)(O[C@@H]3O)O)O)O)C |
InChI | InChI=1S/C20H28O7/c1-8-9-4-5-10-18-11(21)6-7-17(2,3)12(18)15(24)20(26,27-16(18)25)19(10,13(8)22)14(9)23/h9-12,14-16,21,23-26H,1,4-7H2,2-3H3/t9-,10-,11-,12+,14+,15-,16+,18-,19-,20+/m1/s1 |
InChI Key | BTWFVPFIPDEZTE-WHEJKHIGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O7 |
Molecular Weight | 380.40 g/mol |
Exact Mass | 380.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
![2D Structure of (1S,2R,5R,8S,9R,10R,11S,15R,16S,18S)-9,10,15,16,18-pentahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one 2D Structure of (1S,2R,5R,8S,9R,10R,11S,15R,16S,18S)-9,10,15,16,18-pentahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/ad4378d0-855b-11ee-8787-cfb47b83db82.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.09% | 83.82% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.51% | 96.61% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.05% | 96.77% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 90.44% | 95.38% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.83% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 89.47% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.87% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.02% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.34% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.71% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.32% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.89% | 96.43% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.82% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.82% | 97.25% |
CHEMBL4072 | P07858 | Cathepsin B | 82.75% | 93.67% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.56% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rubescens |
PubChem | 162904214 |
LOTUS | LTS0076155 |
wikiData | Q104945902 |