1-[(1S,4aS,7S,7aR)-1-[2-(2-hydroxy-6-methylphenyl)-2-oxoethyl]-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-3-yl]-3-methylbutan-1-one
| Internal ID | 1cbcd359-2ed6-499e-bbf8-64ded674996b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 1-[(1S,4aS,7S,7aR)-1-[2-(2-hydroxy-6-methylphenyl)-2-oxoethyl]-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-3-yl]-3-methylbutan-1-one |
| SMILES (Canonical) | CC1CCC2C1C(OC(=C2C)C(=O)CC(C)C)CC(=O)C3=C(C=CC=C3O)C |
| SMILES (Isomeric) | C[C@H]1CC[C@H]2[C@@H]1[C@@H](OC(=C2C)C(=O)CC(C)C)CC(=O)C3=C(C=CC=C3O)C |
| InChI | InChI=1S/C24H32O4/c1-13(2)11-20(27)24-16(5)17-10-9-15(4)22(17)21(28-24)12-19(26)23-14(3)7-6-8-18(23)25/h6-8,13,15,17,21-22,25H,9-12H2,1-5H3/t15-,17+,21-,22+/m0/s1 |
| InChI Key | MNVFRLHRNDUNBN-UNFFWIPXSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23005950 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.15% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.52% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.01% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.48% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.73% | 96.09% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.00% | 94.80% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.04% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.31% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.94% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.03% | 89.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.37% | 83.10% |
| CHEMBL5028 | O14672 | ADAM10 | 82.91% | 97.50% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.94% | 93.65% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.11% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aphyllocladus denticulatus |
| Lycoseris triplinervia |
| PubChem | 14134086 |
| LOTUS | LTS0054556 |
| wikiData | Q105168615 |