Acuminaminoside
Internal ID | bb4770bb-1818-4ce3-834c-5221a24d5132 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 1-(2-amino-1-benzofuran-3-yl)-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
SMILES (Canonical) | C1=CC=C(C(=C1)CC(=O)C2=C(OC3=CC=CC=C32)N)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=CC=C(C(=C1)CC(=O)C2=C(OC3=CC=CC=C32)N)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C22H23NO8/c23-21-17(12-6-2-4-8-15(12)29-21)13(25)9-11-5-1-3-7-14(11)30-22-20(28)19(27)18(26)16(10-24)31-22/h1-8,16,18-20,22,24,26-28H,9-10,23H2/t16-,18-,19+,20-,22-/m1/s1 |
InChI Key | FSCPLBXCTGZFSA-QKYBYQKWSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H23NO8 |
Molecular Weight | 429.40 g/mol |
Exact Mass | 429.14236669 g/mol |
Topological Polar Surface Area (TPSA) | 156.00 Ų |
XlogP | 1.60 |
Ethanone, 1-(2-amino-3-benzofuranyl)-2-(2-(beta-D-glucopyranosyloxy)phenyl)- |
769954-40-7 |
MLS000563049 |
GAB-521-XX |
CHEMBL1513394 |
HMS2268O13 |
SMR001215824 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.33% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.66% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.63% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.29% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 88.81% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.04% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.30% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.72% | 95.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.61% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.96% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.00% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.12% | 92.62% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.85% | 94.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.73% | 86.33% |
CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 80.15% | 87.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus meghalayensis |
PubChem | 21577089 |
LOTUS | LTS0083046 |
wikiData | Q105000576 |