1-Phenyl-2-propen-1-one
| Internal ID | 518c405a-991d-470d-8b51-74c9d812e7de |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoyl derivatives |
| IUPAC Name | 1-phenylprop-2-en-1-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H8O/c1-2-9(10)8-6-4-3-5-7-8/h2-7H,1H2 |
| InChI Key | KUIZKZHDMPERHR-UHFFFAOYSA-N |
| Popularity | 256 references in papers |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.057514874 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 1.90 |
| 1-Phenyl-2-propen-1-one |
| 3-Oxo-3-phenylpropene |
| Phenyl vinyl ketone |
| Vinyl phenyl ketone |
| Phenylvinylketone |
| 2-Propen-1-one, 1-phenyl- |
| O4QWF7V5AA |
| 1-phenylpropenone |
| NSC-174109 |
| DTXSID30227607 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4282 | P31749 | Serine/threonine-protein kinase AKT |
12270 nM |
IC50 |
PMID: 24321345
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.64% | 95.56% |
| CHEMBL4246 | P42680 | Tyrosine-protein kinase TEC | 86.49% | 82.05% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.61% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.42% | 90.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.57% | 94.62% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.75% | 87.67% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.27% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Styrax benzoin |
| PubChem | 13028 |
| NPASS | NPC245966 |
| ChEMBL | CHEMBL3099615 |