Acetylpepstatin
| Internal ID | 591fb15d-9361-4bb9-95f1-66858374a945 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (3S,4S)-4-[[(2S)-2-[[(3S,4S)-4-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-6-methylheptanoyl]amino]propanoyl]amino]-3-hydroxy-6-methylheptanoic acid |
| SMILES (Canonical) | CC(C)CC(C(CC(=O)O)O)NC(=O)C(C)NC(=O)CC(C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)C)O |
| SMILES (Isomeric) | C[C@@H](C(=O)N[C@@H](CC(C)C)[C@H](CC(=O)O)O)NC(=O)C[C@@H]([C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)C)O |
| InChI | InChI=1S/C31H57N5O9/c1-15(2)11-21(35-30(44)28(18(7)8)36-31(45)27(17(5)6)33-20(10)37)23(38)13-25(40)32-19(9)29(43)34-22(12-16(3)4)24(39)14-26(41)42/h15-19,21-24,27-28,38-39H,11-14H2,1-10H3,(H,32,40)(H,33,37)(H,34,43)(H,35,44)(H,36,45)(H,41,42)/t19-,21-,22-,23-,24-,27-,28-/m0/s1 |
| InChI Key | WKYBEGDEGRCZNF-LBTYKNIQSA-N |
| Popularity | 418 references in papers |
| Molecular Formula | C31H57N5O9 |
| Molecular Weight | 643.80 g/mol |
| Exact Mass | 643.41562841 g/mol |
| Topological Polar Surface Area (TPSA) | 223.00 Ų |
| XlogP | 1.70 |
| Acetylpepstatin |
| 28575-34-0 |
| Acetyl pepstatin |
| (3S,4S)-4-[[(2S)-2-[[(3S,4S)-4-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-6-methylheptanoyl]amino]propanoyl]amino]-3-hydroxy-6-methylheptanoic acid |
| Pepstatin A (acetate) |
| Pepstatin Ac |
| Pepsidin C |
| Pepsidine C |
| 5hvp |
| N-Acetyl Pepstatin |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.60% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.93% | 83.82% |
| CHEMBL3776 | Q14790 | Caspase-8 | 96.67% | 97.06% |
| CHEMBL3308 | P55212 | Caspase-6 | 96.13% | 97.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.00% | 90.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.12% | 85.14% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.94% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.98% | 91.11% |
| CHEMBL4801 | P29466 | Caspase-1 | 91.41% | 96.85% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.60% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.26% | 89.63% |
| CHEMBL3468 | P55210 | Caspase-7 | 88.48% | 95.68% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.81% | 98.05% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.79% | 89.50% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 87.41% | 90.93% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.37% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.23% | 96.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.08% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.20% | 96.47% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.21% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.34% | 94.45% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.09% | 97.21% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 81.11% | 92.29% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.80% | 95.50% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.65% | 97.50% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 80.65% | 89.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5481345 |
| LOTUS | LTS0079190 |
| wikiData | Q76309335 |