Acetylisoniazid
| Internal ID | 444a50ea-cbea-4a17-8bb3-ec5593d801e2 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives |
| IUPAC Name | N'-acetylpyridine-4-carbohydrazide |
| SMILES (Canonical) | CC(=O)NNC(=O)C1=CC=NC=C1 |
| SMILES (Isomeric) | CC(=O)NNC(=O)C1=CC=NC=C1 |
| InChI | InChI=1S/C8H9N3O2/c1-6(12)10-11-8(13)7-2-4-9-5-3-7/h2-5H,1H3,(H,10,12)(H,11,13) |
| InChI Key | CVBGNAKQQUWBQV-UHFFFAOYSA-N |
| Popularity | 85 references in papers |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.069476538 g/mol |
| Topological Polar Surface Area (TPSA) | 71.10 Ų |
| XlogP | -0.40 |
| Acetyl isoniazid |
| 1078-38-2 |
| N'-acetylpyridine-4-carbohydrazide |
| N-Acetylisoniazid |
| (N)1-Acetylisoniazid |
| 1-Acetyl-2-isonicotinoylhydrazine |
| N-Acetylisonicotinylhydrazide |
| N'-acetylisoniazid |
| N-acetyl-N'-isonicotinoylhydrazine |
| Acetyl Isoniazid-d4 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
89.1 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 95.91% | 81.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.57% | 96.09% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 87.92% | 87.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.57% | 94.73% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.85% | 93.10% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.74% | 98.75% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.73% | 98.59% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.03% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.64% | 90.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.13% | 96.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.37% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71602 |
| LOTUS | LTS0207086 |
| wikiData | Q27107456 |