N-Acetyl-L-Cysteine
| Internal ID | 2b9b1a20-63ff-4e4c-bf57-e1e2732c5f98 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids > N-acyl-L-alpha-amino acids |
| IUPAC Name | (2R)-2-acetamido-3-sulfanylpropanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1 |
| InChI Key | PWKSKIMOESPYIA-BYPYZUCNSA-N |
| Popularity | 22,563 references in papers |
| Molecular Formula | C5H9NO3S |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.03031432 g/mol |
| Topological Polar Surface Area (TPSA) | 67.40 Ų |
| XlogP | 0.40 |
| Atomic LogP (AlogP) | -0.49 |
| H-Bond Acceptor | 3 |
| H-Bond Donor | 3 |
| Rotatable Bonds | 3 |
| acetylcysteine |
| 616-91-1 |
| N-Acetylcysteine |
| mercapturic acid |
| Acetadote |
| L-Acetylcysteine |
| Fluimucetin |
| Respaire |
| Acetilcisteina |
| N-Acetyl cysteine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7734 | 77.34% |
| Caco-2 | - | 0.9420 | 94.20% |
| Blood Brain Barrier | + | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.8143 | 81.43% |
| Subcellular localzation | Mitochondria | 0.5896 | 58.96% |
| OATP2B1 inhibitior | - | 0.8411 | 84.11% |
| OATP1B1 inhibitior | + | 0.9476 | 94.76% |
| OATP1B3 inhibitior | + | 0.9486 | 94.86% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 1.0000 | 100.00% |
| BSEP inhibitior | - | 0.9558 | 95.58% |
| P-glycoprotein inhibitior | - | 0.9810 | 98.10% |
| P-glycoprotein substrate | - | 0.9379 | 93.79% |
| CYP3A4 substrate | - | 0.6847 | 68.47% |
| CYP2C9 substrate | + | 0.5855 | 58.55% |
| CYP2D6 substrate | - | 0.8823 | 88.23% |
| CYP3A4 inhibition | - | 0.9642 | 96.42% |
| CYP2C9 inhibition | - | 0.9269 | 92.69% |
| CYP2C19 inhibition | - | 0.9518 | 95.18% |
| CYP2D6 inhibition | - | 0.9673 | 96.73% |
| CYP1A2 inhibition | - | 0.9063 | 90.63% |
| CYP2C8 inhibition | - | 0.9952 | 99.52% |
| CYP inhibitory promiscuity | - | 0.9853 | 98.53% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.7294 | 72.94% |
| Eye corrosion | - | 0.9886 | 98.86% |
| Eye irritation | - | 0.9541 | 95.41% |
| Skin irritation | - | 0.7687 | 76.87% |
| Skin corrosion | - | 0.9552 | 95.52% |
| Ames mutagenesis | + | 0.7200 | 72.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.8640 | 86.40% |
| Micronuclear | - | 0.5100 | 51.00% |
| Hepatotoxicity | - | 0.7500 | 75.00% |
| skin sensitisation | - | 0.9431 | 94.31% |
| Respiratory toxicity | + | 0.8000 | 80.00% |
| Reproductive toxicity | - | 0.6701 | 67.01% |
| Mitochondrial toxicity | + | 0.8000 | 80.00% |
| Nephrotoxicity | + | 0.5892 | 58.92% |
| Acute Oral Toxicity (c) | IV | 0.6328 | 63.28% |
| Estrogen receptor binding | - | 0.9031 | 90.31% |
| Androgen receptor binding | - | 0.9046 | 90.46% |
| Thyroid receptor binding | - | 0.9184 | 91.84% |
| Glucocorticoid receptor binding | - | 0.9152 | 91.52% |
| Aromatase binding | - | 0.8298 | 82.98% |
| PPAR gamma | - | 0.7094 | 70.94% |
| Honey bee toxicity | - | 0.9376 | 93.76% |
| Biodegradation | + | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | - | 0.8400 | 84.00% |
| Fish aquatic toxicity | - | 0.8161 | 81.61% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
25.1 nM 25.1 nM |
Potency Potency |
via CMAUP
via Super-PRED |
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
1412.5 nM |
Potency |
via CMAUP
|
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
1000 nM 1000 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
25118.9 nM |
Potency |
via CMAUP
|
| CHEMBL4040 | P28482 | MAP kinase ERK2 |
199.5 nM |
Potency |
via Super-PRED
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
31622.8 nM 17782.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit |
4466.8 nM 4466.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
1584.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293256 | P40225 | Thrombopoietin |
31622.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
562.3 nM 562.3 nM |
Potency Potency |
via Super-PRED
via CMAUP |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 93.92% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.79% | 90.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.00% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.47% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.25% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.23% | 91.19% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.79% | 95.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.66% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.06% | 93.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.30% | 90.20% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 81.03% | 92.29% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.76% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actaea simplex |
| Allium sativum |
| Arabidopsis thaliana |