Acetyl daidzin
Internal ID | bc4fdabf-d9a8-4c8c-b61e-edf7f3c8697d |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COCC1C(C(C(C(O1)OC2=CC3=C(C=C2)C(=O)C(=CO3)C4=CC=C(C=C4)O)O)O)O |
SMILES (Isomeric) | COC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC3=C(C=C2)C(=O)C(=CO3)C4=CC=C(C=C4)O)O)O)O |
InChI | InChI=1S/C22H22O9/c1-28-10-17-19(25)20(26)21(27)22(31-17)30-13-6-7-14-16(8-13)29-9-15(18(14)24)11-2-4-12(23)5-3-11/h2-9,17,19-23,25-27H,10H2,1H3/t17-,19-,20+,21-,22-/m1/s1 |
InChI Key | YPZQEVRAECOAPU-MIUGBVLSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O9 |
Molecular Weight | 430.40 g/mol |
Exact Mass | 430.12638228 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | 0.70 |
YPZQEVRAECOAPU-MIUGBVLSSA-N |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.93% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.20% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.14% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.66% | 96.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 91.46% | 98.35% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.56% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.32% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.22% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.70% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.82% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.52% | 91.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.34% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.30% | 95.56% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.99% | 93.31% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.92% | 95.78% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.81% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.80% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.70% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.01% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.00% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycine max |
PubChem | 102028680 |
LOTUS | LTS0081035 |
wikiData | Q104391046 |