(2S,3R,4S,5S,6R)-2-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13S,15R,16R,18S)-15-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | fd250eab-488c-496f-b88d-3c4e0292bc2c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13S,15R,16R,18S)-15-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CC(C(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)O)O)O)O)O)C)C)C)OC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(C[C@H]([C@@H](C6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)O)C)C)C)OC1 |
InChI | InChI=1S/C39H64O14/c1-17-7-10-39(48-16-17)18(2)28-25(53-39)12-22-20-6-5-19-11-24(23(42)13-38(19,4)21(20)8-9-37(22,28)3)49-35-33(47)31(45)34(27(15-41)51-35)52-36-32(46)30(44)29(43)26(14-40)50-36/h17-36,40-47H,5-16H2,1-4H3/t17-,18+,19+,20-,21+,22+,23-,24-,25+,26-,27-,28+,29-,30+,31-,32-,33-,34+,35-,36+,37+,38+,39-/m1/s1 |
InChI Key | BOFSXGGSAUTBNA-YROJOSQZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H64O14 |
Molecular Weight | 756.90 g/mol |
Exact Mass | 756.42960671 g/mol |
Topological Polar Surface Area (TPSA) | 217.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.34% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.99% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.98% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.71% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 93.45% | 98.10% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.70% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.20% | 95.50% |
CHEMBL233 | P35372 | Mu opioid receptor | 92.09% | 97.93% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.23% | 96.21% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.65% | 92.86% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.75% | 95.93% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 88.82% | 97.86% |
CHEMBL204 | P00734 | Thrombin | 88.00% | 96.01% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.96% | 97.25% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.75% | 92.50% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.13% | 89.05% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.07% | 95.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.03% | 95.89% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.70% | 95.58% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.35% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.29% | 95.89% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.36% | 96.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.31% | 94.45% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.74% | 97.28% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.21% | 97.31% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.06% | 86.92% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 82.08% | 96.67% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.95% | 96.77% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.95% | 95.83% |
CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 80.91% | 100.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.65% | 97.29% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.26% | 100.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.22% | 99.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.04% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 21607801 |
LOTUS | LTS0073204 |
wikiData | Q104939214 |