17-(5-ethyl-6-methylhept-2-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
Internal ID | eb00d84e-6731-4fe6-94fb-62e8f8c6f409 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 17-(5-ethyl-6-methylhept-2-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CCC(CC=C(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)C(C)C |
SMILES (Isomeric) | CCC(CC=C(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)C(C)C |
InChI | InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8,10,19,21,23-27,30H,7,9,11-18H2,1-6H3 |
InChI Key | HZYXFRGVBOPPNZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H48O |
Molecular Weight | 412.70 g/mol |
Exact Mass | 412.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 8.90 |
There are no found synonyms. |
![2D Structure of 17-(5-ethyl-6-methylhept-2-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol 2D Structure of 17-(5-ethyl-6-methylhept-2-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol](https://plantaedb.com/storage/docs/compounds/2023/11/acbcd430-85f6-11ee-aed9-6902e4c8bb74.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.44% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.17% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.05% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.44% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.87% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.62% | 91.11% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.75% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.51% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.31% | 93.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.82% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.70% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.75% | 90.71% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.36% | 96.43% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.05% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.15% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.11% | 89.05% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.00% | 94.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.30% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.56% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Blainvillea acmella |
Mikania cordata |
PubChem | 85767808 |
LOTUS | LTS0092707 |
wikiData | Q105035961 |