18-Methoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15(20),16,18-triene-13,21-dione
| Internal ID | bc4ea8ce-ced2-4003-8142-ff6409a02a6d |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 18-methoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15(20),16,18-triene-13,21-dione |
| SMILES (Canonical) | CN1CCC23C4C5C(CC2=O)C6(C1)C(O6)COC5CC(=O)N4C7=C3C=C(C=C7)OC |
| SMILES (Isomeric) | CN1CCC23C4C5C(CC2=O)C6(C1)C(O6)COC5CC(=O)N4C7=C3C=C(C=C7)OC |
| InChI | InChI=1S/C23H26N2O5/c1-24-6-5-22-13-7-12(28-2)3-4-15(13)25-19(27)9-16-20(21(22)25)14(8-17(22)26)23(11-24)18(30-23)10-29-16/h3-4,7,14,16,18,20-21H,5-6,8-11H2,1-2H3 |
| InChI Key | NLKBFRHZXRCIQI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.18417193 g/mol |
| Topological Polar Surface Area (TPSA) | 71.60 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
![2D Structure of 18-Methoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15(20),16,18-triene-13,21-dione](https://plantaedb.com/storage/docs/compounds/2023/11/acaf9300-85af-11ee-80bf-ad21ed1fa78f.jpg "2D Structure of 18-Methoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15(20),16,18-triene-13,21-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.84% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.81% | 93.40% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.79% | 94.00% |
| CHEMBL204 | P00734 | Thrombin | 96.17% | 96.01% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.73% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.34% | 86.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.81% | 90.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.78% | 85.14% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 93.56% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.01% | 96.00% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 87.79% | 95.53% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.58% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.43% | 91.11% |
| CHEMBL4158 | P49327 | Fatty acid synthase | 85.58% | 82.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.91% | 99.23% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.51% | 97.33% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.72% | 97.53% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.73% | 96.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.65% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.53% | 97.09% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.27% | 93.10% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.22% | 91.03% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.44% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Strychnos icaja |
| PubChem | 162947529 |
| LOTUS | LTS0163933 |
| wikiData | Q105181381 |