3-[(3S,6S,9R,12S,15S,18S,24S,27R,28R,31S)-3-(2-amino-2-oxoethyl)-21-ethylidene-27-hydroxy-15,18-bis[(1R)-1-hydroxyethyl]-6-[(1R)-1-methoxyethyl]-4,9-dimethyl-2,5,8,11,14,17,20,23,26,30-decaoxo-28-[(2S)-13-oxohexadecan-2-yl]-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29-decazabicyclo[29.3.0]tetratriacontan-12-yl]propanamide
| Internal ID | e5f37dbd-0540-498f-b075-5082b01fc86f |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 3-[(3S,6S,9R,12S,15S,18S,24S,27R,28R,31S)-3-(2-amino-2-oxoethyl)-21-ethylidene-27-hydroxy-15,18-bis[(1R)-1-hydroxyethyl]-6-[(1R)-1-methoxyethyl]-4,9-dimethyl-2,5,8,11,14,17,20,23,26,30-decaoxo-28-[(2S)-13-oxohexadecan-2-yl]-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29-decazabicyclo[29.3.0]tetratriacontan-12-yl]propanamide |
| SMILES (Canonical) | CCCC(=O)CCCCCCCCCCC(C)C1C(C(=O)NC(C(=O)NC(=CC)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC(=O)N)C)C(C)OC)C)CCC(=O)N)C(C)O)C(C)O)C(C)C)O |
| SMILES (Isomeric) | CCCC(=O)CCCCCCCCCC[C@H](C)[C@@H]1[C@H](C(=O)N[C@H](C(=O)NC(=CC)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N2CCC[C@H]2C(=O)N1)CC(=O)N)C)[C@@H](C)OC)C)CCC(=O)N)[C@@H](C)O)[C@@H](C)O)C(C)C)O |
| InChI | InChI=1S/C59H100N12O17/c1-12-23-37(74)25-21-19-17-15-14-16-18-20-24-32(5)45-49(77)57(85)65-44(31(3)4)54(82)63-38(13-2)51(79)67-47(35(8)73)56(84)68-46(34(7)72)55(83)64-39(27-28-42(60)75)52(80)62-33(6)50(78)69-48(36(9)88-11)59(87)70(10)41(30-43(61)76)58(86)71-29-22-26-40(71)53(81)66-45/h13,31-36,39-41,44-49,72-73,77H,12,14-30H2,1-11H3,(H2,60,75)(H2,61,76)(H,62,80)(H,63,82)(H,64,83)(H,65,85)(H,66,81)(H,67,79)(H,68,84)(H,69,78)/t32-,33+,34+,35+,36+,39-,40-,41-,44-,45+,46-,47-,48-,49+/m0/s1 |
| InChI Key | MUPONHUIXXXUHO-NRPVQLKLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C59H100N12O17 |
| Molecular Weight | 1249.50 g/mol |
| Exact Mass | 1248.73293977 g/mol |
| Topological Polar Surface Area (TPSA) | 447.00 Ų |
| XlogP | 1.30 |
| Atomic LogP (AlogP) | -1.89 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 24 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6767 | 67.67% |
| Caco-2 | - | 0.8602 | 86.02% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.8143 | 81.43% |
| Subcellular localzation | Mitochondria | 0.5842 | 58.42% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8090 | 80.90% |
| OATP1B3 inhibitior | + | 0.8900 | 89.00% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8817 | 88.17% |
| BSEP inhibitior | + | 0.9167 | 91.67% |
| P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
| P-glycoprotein substrate | + | 0.8876 | 88.76% |
| CYP3A4 substrate | + | 0.7416 | 74.16% |
| CYP2C9 substrate | - | 0.7908 | 79.08% |
| CYP2D6 substrate | - | 0.8690 | 86.90% |
| CYP3A4 inhibition | - | 0.8799 | 87.99% |
| CYP2C9 inhibition | - | 0.8650 | 86.50% |
| CYP2C19 inhibition | - | 0.8685 | 86.85% |
| CYP2D6 inhibition | - | 0.9247 | 92.47% |
| CYP1A2 inhibition | - | 0.8630 | 86.30% |
| CYP2C8 inhibition | + | 0.7491 | 74.91% |
| CYP inhibitory promiscuity | - | 0.9845 | 98.45% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.5538 | 55.38% |
| Eye corrosion | - | 0.9851 | 98.51% |
| Eye irritation | - | 0.8963 | 89.63% |
| Skin irritation | - | 0.7616 | 76.16% |
| Skin corrosion | - | 0.9064 | 90.64% |
| Ames mutagenesis | - | 0.7037 | 70.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6597 | 65.97% |
| Micronuclear | + | 0.7800 | 78.00% |
| Hepatotoxicity | - | 0.5019 | 50.19% |
| skin sensitisation | - | 0.8667 | 86.67% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.6973 | 69.73% |
| Acute Oral Toxicity (c) | III | 0.6452 | 64.52% |
| Estrogen receptor binding | + | 0.6594 | 65.94% |
| Androgen receptor binding | + | 0.7134 | 71.34% |
| Thyroid receptor binding | + | 0.6087 | 60.87% |
| Glucocorticoid receptor binding | + | 0.7211 | 72.11% |
| Aromatase binding | + | 0.7278 | 72.78% |
| PPAR gamma | + | 0.7840 | 78.40% |
| Honey bee toxicity | - | 0.6996 | 69.96% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.5176 | 51.76% |
| Fish aquatic toxicity | + | 0.7297 | 72.97% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.65% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.62% | 96.09% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 99.60% | 95.92% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 99.28% | 94.75% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.10% | 90.08% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.05% | 94.66% |
| CHEMBL3837 | P07711 | Cathepsin L | 97.39% | 96.61% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 97.39% | 82.38% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.95% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.15% | 94.45% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 95.63% | 93.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 95.40% | 95.89% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 95.14% | 96.31% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.41% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.33% | 97.25% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 93.51% | 95.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.44% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.10% | 96.47% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 93.00% | 97.05% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.59% | 95.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.35% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.28% | 95.56% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 92.26% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.12% | 85.14% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.18% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.64% | 90.71% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 89.99% | 92.12% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.03% | 95.71% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.70% | 83.82% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.64% | 93.03% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 88.44% | 97.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.40% | 100.00% |
| CHEMBL1949 | P62937 | Cyclophilin A | 88.35% | 98.57% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 87.84% | 94.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.55% | 99.17% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.18% | 89.50% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 87.16% | 92.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.90% | 93.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 86.67% | 97.64% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.30% | 96.43% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.87% | 91.81% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.74% | 99.23% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 85.70% | 98.03% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 85.58% | 95.27% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.46% | 92.32% |
| CHEMBL228 | P31645 | Serotonin transporter | 84.52% | 95.51% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.29% | 82.69% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.22% | 89.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.09% | 97.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.96% | 97.29% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.91% | 91.03% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.43% | 98.75% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.11% | 96.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.72% | 92.86% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.37% | 98.33% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 81.28% | 92.38% |
| CHEMBL2474 | P53582 | Methionine aminopeptidase 1 | 81.16% | 97.09% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 81.10% | 97.63% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.61% | 88.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.36% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163085107 |
| LOTUS | LTS0124043 |
| wikiData | Q105172648 |