[(2S,3S,4R,5S)-2-[(2R,3S,4R,5R,6R)-6-(acetyloxymethyl)-4-[(2S,3R,4S,5R,6S)-6-(acetyloxymethyl)-3,5-dihydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-3-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-(hydroxymethyl)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxolan-3-yl] benzoate
Internal ID | 1344e02e-cf20-4fff-ae92-348e87e0b574 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4R,5S)-2-[(2R,3S,4R,5R,6R)-6-(acetyloxymethyl)-4-[(2S,3R,4S,5R,6S)-6-(acetyloxymethyl)-3,5-dihydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-3-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-(hydroxymethyl)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxolan-3-yl] benzoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)OC4(C(C(C(O4)CO)O)OC(=O)C5=CC=CC=C5)COC(=O)C=CC6=CC=C(C=C6)O)COC(=O)C)OC(=O)C=CC7=CC=C(C=C7)O)O)OC8C(C(C(C(O8)CO)O)O)O)O |
SMILES (Isomeric) | CC(=O)OC[C@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@@H]([C@H](O[C@@H]([C@H]2O[C@H]3[C@H]([C@@H]([C@H]([C@H](O3)CO)O)O)O)O[C@]4([C@H]([C@@H]([C@@H](O4)CO)O)OC(=O)C5=CC=CC=C5)COC(=O)/C=C/C6=CC=C(C=C6)O)COC(=O)C)OC(=O)/C=C/C7=CC=C(C=C7)O)O)O[C@@H]8[C@H]([C@@H]([C@H]([C@@H](O8)CO)O)O)O)O |
InChI | InChI=1S/C59H72O33/c1-26(63)79-23-36-42(71)50(87-55-46(75)44(73)40(69)33(20-60)82-55)48(77)57(84-36)88-51-49(86-39(68)19-13-29-10-16-32(66)17-11-29)37(24-80-27(2)64)85-58(52(51)89-56-47(76)45(74)41(70)34(21-61)83-56)92-59(25-81-38(67)18-12-28-8-14-31(65)15-9-28)53(43(72)35(22-62)91-59)90-54(78)30-6-4-3-5-7-30/h3-19,33-37,40-53,55-58,60-62,65-66,69-77H,20-25H2,1-2H3/b18-12+,19-13+/t33-,34+,35-,36-,37+,40-,41-,42+,43+,44+,45+,46-,47-,48+,49+,50-,51+,52-,53-,55+,56-,57-,58+,59-/m0/s1 |
InChI Key | IMBDWRYPYUQSAB-YVLPDZSJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H72O33 |
Molecular Weight | 1309.20 g/mol |
Exact Mass | 1308.3955847 g/mol |
Topological Polar Surface Area (TPSA) | 498.00 Ų |
XlogP | -2.30 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4R,5S)-2-[(2R,3S,4R,5R,6R)-6-(acetyloxymethyl)-4-[(2S,3R,4S,5R,6S)-6-(acetyloxymethyl)-3,5-dihydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-3-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-(hydroxymethyl)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxolan-3-yl] benzoate 2D Structure of [(2S,3S,4R,5S)-2-[(2R,3S,4R,5R,6R)-6-(acetyloxymethyl)-4-[(2S,3R,4S,5R,6S)-6-(acetyloxymethyl)-3,5-dihydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-3-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-(hydroxymethyl)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxolan-3-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/ac6e4220-8639-11ee-84ee-1d14d7d8ad7f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.81% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.72% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.52% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.14% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.92% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.30% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.17% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.36% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.93% | 89.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 88.73% | 89.44% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.24% | 99.17% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.21% | 83.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.13% | 94.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.34% | 95.56% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 87.04% | 89.67% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.58% | 99.23% |
CHEMBL5028 | O14672 | ADAM10 | 82.87% | 97.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.79% | 95.93% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.42% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.38% | 90.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.94% | 90.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.87% | 92.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.85% | 91.19% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.29% | 95.83% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.25% | 88.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.08% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygala tenuifolia |
PubChem | 163044376 |
LOTUS | LTS0041042 |
wikiData | Q105115580 |