6-[3-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxy-10-[6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3-benzodioxol-5-yl]-7H-[2]benzofuro[5,6-g][1,3]benzodioxol-9-one
| Internal ID | 6ac50a4c-48f4-436c-b446-2ed99827ed76 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | 6-[3-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxy-10-[6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3-benzodioxol-5-yl]-7H-[2]benzofuro[5,6-g][1,3]benzodioxol-9-one |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(CO3)(CO)O)O)OC4=C5COC(=O)C5=C(C6=C4C=CC7=C6OCO7)C8=CC9=C(C=C8OC1C(C(C(C(O1)C)O)O)O)OCO9)COC1C(C(C(CO1)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(CO3)(CO)O)O)OC4=C5COC(=O)C5=C(C6=C4C=CC7=C6OCO7)C8=CC9=C(C=C8OC1C(C(C(C(O1)C)O)O)O)OCO9)COC1C(C(C(CO1)O)O)O)O)O)O)O |
| InChI | InChI=1S/C48H58O29/c1-14-28(51)32(55)35(58)44(71-14)73-21-6-23-22(68-12-69-23)5-17(21)25-26-16(3-4-20-38(26)70-13-67-20)37(18-7-63-42(61)27(18)25)75-46-40(77-47-41(60)48(62,10-49)11-66-47)39(76-45-36(59)33(56)29(52)15(2)72-45)31(54)24(74-46)9-65-43-34(57)30(53)19(50)8-64-43/h3-6,14-15,19,24,28-36,39-41,43-47,49-60,62H,7-13H2,1-2H3 |
| InChI Key | HVJFERTWOLDIQF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C48H58O29 |
| Molecular Weight | 1099.00 g/mol |
| Exact Mass | 1098.30637581 g/mol |
| Topological Polar Surface Area (TPSA) | 419.00 Ų |
| XlogP | -4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 99.68% | 96.77% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.47% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.96% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.83% | 95.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.81% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.80% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.43% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.64% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.32% | 94.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 94.67% | 94.80% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.53% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.42% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.26% | 90.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.09% | 92.62% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.22% | 96.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.45% | 96.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.42% | 95.89% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 84.79% | 97.31% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.57% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.61% | 96.09% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 83.50% | 97.78% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 82.65% | 96.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.18% | 97.36% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.12% | 96.95% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.03% | 95.53% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.76% | 95.83% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 80.93% | 83.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.08% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acanthus mollis |
| PubChem | 74951435 |
| LOTUS | LTS0066848 |
| wikiData | Q105244388 |