[(2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2R,3S,4R)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] (1S)-1-hydroxy-6-oxocyclohex-2-ene-1-carboxylate
| Internal ID | 50e356b8-3725-458a-b1c7-7be7733ed4e1 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | [(2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2R,3S,4R)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] (1S)-1-hydroxy-6-oxocyclohex-2-ene-1-carboxylate |
| SMILES (Canonical) | C1CC(=O)C(C=C1)(C(=O)OC2CC3=C(C(=C(C=C3O)O)C4C(C(OC5=C(C(=CC(=C45)O)O)C6C(C(OC7=CC(=CC(=C67)O)O)C8=CC(=C(C=C8)O)O)O)C9=CC(=C(C=C9)O)O)O)OC2C1=CC(=C(C=C1)O)O)O |
| SMILES (Isomeric) | C1CC(=O)[C@@](C=C1)(C(=O)O[C@H]2CC3=C(C(=C(C=C3O)O)[C@H]4[C@@H]([C@H](OC5=C(C(=CC(=C45)O)O)[C@@H]6[C@H]([C@H](OC7=CC(=CC(=C67)O)O)C8=CC(=C(C=C8)O)O)O)C9=CC(=C(C=C9)O)O)O)O[C@@H]2C1=CC(=C(C=C1)O)O)O |
| InChI | InChI=1S/C52H44O21/c53-22-14-31(61)38-35(15-22)70-47(20-5-8-25(55)29(59)12-20)44(66)42(38)40-33(63)18-34(64)41-43(45(67)48(73-50(40)41)21-6-9-26(56)30(60)13-21)39-32(62)17-27(57)23-16-36(71-51(68)52(69)10-2-1-3-37(52)65)46(72-49(23)39)19-4-7-24(54)28(58)11-19/h2,4-15,17-18,36,42-48,53-64,66-67,69H,1,3,16H2/t36-,42+,43+,44+,45-,46+,47+,48+,52-/m0/s1 |
| InChI Key | LSIGTTOGQNKJQP-KKNVNZMLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C52H44O21 |
| Molecular Weight | 1004.90 g/mol |
| Exact Mass | 1004.23750841 g/mol |
| Topological Polar Surface Area (TPSA) | 375.00 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.82% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.82% | 83.82% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.53% | 91.49% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 96.73% | 96.12% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.68% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.87% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.69% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.51% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.19% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.02% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.59% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.08% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.94% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.70% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.57% | 98.95% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 86.07% | 97.33% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.23% | 95.78% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.28% | 96.37% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.59% | 96.39% |
| CHEMBL3572 | P11597 | Cholesteryl ester transfer protein | 82.02% | 92.67% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.13% | 83.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.21% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Salix sieboldiana |
| PubChem | 162892751 |
| LOTUS | LTS0073881 |
| wikiData | Q105156551 |