Ac-Phe-D-Iva-Gln-Aib-Ile-Thr-Aib-Leu-Aib-Hyp-Gln-Aib-Hyp-Aib-Pro-Phe-Ser-OH
Internal ID | 092ee5f3-d98c-4f11-872e-0c702e21bbac |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-1-[2-[[(2S,4R)-1-[2-[[(2S)-2-[[(2S,4R)-1-[2-[[(2S)-2-[[2-[[(2S,3R)-2-[[(2S,3S)-2-[[2-[[(2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-methylbutanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylpropanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-2-methylpropanoyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]-4-hydroxypyrrolidine-2-carbonyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylpropanoyl]-4-hydroxypyrrolidine-2-carbonyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid |
SMILES (Canonical) | CCC(C)C(C(=O)NC(C(C)O)C(=O)NC(C)(C)C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)N1CC(CC1C(=O)NC(CCC(=O)N)C(=O)NC(C)(C)C(=O)N2CC(CC2C(=O)NC(C)(C)C(=O)N3CCCC3C(=O)NC(CC4=CC=CC=C4)C(=O)NC(CO)C(=O)O)O)O)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)(CC)NC(=O)C(CC5=CC=CC=C5)NC(=O)C |
SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)N[C@@H]([C@@H](C)O)C(=O)NC(C)(C)C(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)N1C[C@@H](C[C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)NC(C)(C)C(=O)N2C[C@@H](C[C@H]2C(=O)NC(C)(C)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)N[C@@H](CO)C(=O)O)O)O)NC(=O)C(C)(C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@@](C)(CC)NC(=O)[C@H](CC5=CC=CC=C5)NC(=O)C |
InChI | InChI=1S/C89H137N19O25/c1-19-47(5)65(99-79(129)85(10,11)100-69(118)55(34-36-64(91)115)96-80(130)89(18,20-2)105-71(120)58(92-49(7)111)40-51-30-25-22-26-31-51)75(124)98-66(48(6)110)76(125)104-84(8,9)78(128)97-56(38-46(3)4)70(119)102-88(16,17)82(132)107-43-52(112)41-61(107)73(122)93-54(33-35-63(90)114)68(117)101-87(14,15)83(133)108-44-53(113)42-62(108)74(123)103-86(12,13)81(131)106-37-27-32-60(106)72(121)94-57(39-50-28-23-21-24-29-50)67(116)95-59(45-109)77(126)127/h21-26,28-31,46-48,52-62,65-66,109-110,112-113H,19-20,27,32-45H2,1-18H3,(H2,90,114)(H2,91,115)(H,92,111)(H,93,122)(H,94,121)(H,95,116)(H,96,130)(H,97,128)(H,98,124)(H,99,129)(H,100,118)(H,101,117)(H,102,119)(H,103,123)(H,104,125)(H,105,120)(H,126,127)/t47-,48+,52+,53+,54-,55-,56-,57-,58-,59-,60-,61-,62-,65-,66-,89+/m0/s1 |
InChI Key | CAUFVUKRMWMYQC-CTQTVTFFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C89H137N19O25 |
Molecular Weight | 1873.20 g/mol |
Exact Mass | 1872.00330093 g/mol |
Topological Polar Surface Area (TPSA) | 673.00 Ų |
XlogP | -2.10 |
There are no found synonyms. |
![2D Structure of Ac-Phe-D-Iva-Gln-Aib-Ile-Thr-Aib-Leu-Aib-Hyp-Gln-Aib-Hyp-Aib-Pro-Phe-Ser-OH 2D Structure of Ac-Phe-D-Iva-Gln-Aib-Ile-Thr-Aib-Leu-Aib-Hyp-Gln-Aib-Hyp-Aib-Pro-Phe-Ser-OH](https://plantaedb.com/storage/docs/compounds/2023/11/ac-phe-d-iva-gln-aib-ile-thr-aib-leu-aib-hyp-gln-aib-hyp-aib-pro-phe-ser-oh.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
CHEMBL3837 | P07711 | Cathepsin L | 99.91% | 96.61% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.29% | 90.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.89% | 93.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.85% | 96.09% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.85% | 98.33% |
CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 98.62% | 98.94% |
CHEMBL220 | P22303 | Acetylcholinesterase | 98.42% | 94.45% |
CHEMBL4123 | P30989 | Neurotensin receptor 1 | 97.98% | 96.67% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 97.46% | 97.14% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.44% | 100.00% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 97.43% | 97.64% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 96.73% | 96.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.89% | 97.09% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.57% | 95.38% |
CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 95.20% | 97.43% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 94.90% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.63% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.05% | 95.56% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.44% | 97.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.38% | 91.19% |
CHEMBL4801 | P29466 | Caspase-1 | 91.39% | 96.85% |
CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 91.33% | 97.50% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.18% | 96.47% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.43% | 96.00% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.23% | 91.81% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.14% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.85% | 93.00% |
CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 89.47% | 92.80% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 89.16% | 88.42% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 88.54% | 96.67% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.55% | 99.17% |
CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 86.20% | 93.33% |
CHEMBL5028 | O14672 | ADAM10 | 85.89% | 97.50% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 85.79% | 96.37% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.20% | 95.89% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 85.03% | 100.00% |
CHEMBL3176 | O43603 | Galanin receptor 2 | 85.00% | 98.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.65% | 91.11% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.16% | 100.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.00% | 93.03% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.48% | 90.71% |
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 81.41% | 95.52% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.69% | 95.83% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.32% | 82.69% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.11% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos icaja |
PubChem | 163058043 |
LOTUS | LTS0252554 |
wikiData | Q105362916 |