Ac-DL-Leu-DL-Arg-DL-Leu-DL-Phe-Abu(2,3-dehydro)-DL-Trp-OH
| Internal ID | 4b5aeaf2-af66-429c-8fd0-a8912925508d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[2-[[2-[[2-[[2-[(2-acetamido-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]but-2-enoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES (Canonical) | CC=C(C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)O)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(CC(C)C)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)C |
| SMILES (Isomeric) | CC=C(C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)O)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(CC(C)C)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)C |
| InChI | InChI=1S/C44H62N10O8/c1-7-31(38(56)54-37(43(61)62)23-29-24-48-32-17-12-11-16-30(29)32)50-42(60)36(22-28-14-9-8-10-15-28)53-41(59)35(21-26(4)5)52-39(57)33(18-13-19-47-44(45)46)51-40(58)34(20-25(2)3)49-27(6)55/h7-12,14-17,24-26,33-37,48H,13,18-23H2,1-6H3,(H,49,55)(H,50,60)(H,51,58)(H,52,57)(H,53,59)(H,54,56)(H,61,62)(H4,45,46,47) |
| InChI Key | FNLWZPVZZIMJBT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C44H62N10O8 |
| Molecular Weight | 859.00 g/mol |
| Exact Mass | 858.47520897 g/mol |
| Topological Polar Surface Area (TPSA) | 292.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.97% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.71% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 98.06% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.16% | 96.09% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 95.87% | 83.10% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.49% | 91.81% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.42% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.31% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.27% | 90.17% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.65% | 98.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.55% | 99.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.40% | 97.64% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 93.25% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 93.25% | 95.38% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 92.76% | 99.52% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.20% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.45% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.39% | 98.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.42% | 95.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.12% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.59% | 83.82% |
| CHEMBL4072 | P07858 | Cathepsin B | 87.07% | 93.67% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 85.48% | 96.28% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.32% | 97.23% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.29% | 87.45% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.52% | 100.00% |
| CHEMBL5028 | O14672 | ADAM10 | 84.50% | 97.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.00% | 100.00% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 83.42% | 97.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.96% | 94.08% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.46% | 91.49% |
| CHEMBL1808 | P12821 | Angiotensin-converting enzyme | 81.06% | 93.39% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 80.97% | 88.42% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 80.89% | 88.10% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.71% | 89.62% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.29% | 88.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162816304 |
| LOTUS | LTS0103482 |
| wikiData | Q104166565 |