Ac-Aib-Pro-Aib-D-Ala-Aib-Ala-Gln-Aib-Val-Aib-Gly-Leu-Aib-Pro-D-Val-Aib-Aib-Gln-Gln-Phe-ol
| Internal ID | 6258395b-aebb-4bcc-95b2-992c3505d84b |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[2-[[(2S)-1-(2-acetamido-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-N-[1-[[(2S)-1-[[1-[[2-[[(2S)-1-[[1-[(2S)-2-[[(2R)-1-[[1-[[1-[[(2S)-5-amino-1-[[(2S)-5-amino-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]pentanediamide |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=CC=C2)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C3CCCN3C(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)NC(C)(C)C(=O)N[C@@H](C(C)C)C(=O)NC(C)(C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC2=CC=CC=C2)CO)NC(=O)C(C)(C)NC(=O)[C@@H](C)NC(=O)C(C)(C)NC(=O)[C@@H]3CCCN3C(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C92H151N23O24/c1-47(2)43-58(72(127)109-92(24,25)84(139)114-41-29-33-59(114)73(128)104-65(48(3)4)75(130)112-90(20,21)82(137)113-89(18,19)80(135)103-56(36-39-62(94)119)70(125)102-55(35-38-61(93)118)69(124)99-54(46-116)44-53-31-27-26-28-32-53)100-64(121)45-96-77(132)85(10,11)111-76(131)66(49(5)6)105-81(136)88(16,17)108-71(126)57(37-40-63(95)120)101-67(122)50(7)97-78(133)86(12,13)107-68(123)51(8)98-79(134)87(14,15)110-74(129)60-34-30-42-115(60)83(138)91(22,23)106-52(9)117/h26-28,31-32,47-51,54-60,65-66,116H,29-30,33-46H2,1-25H3,(H2,93,118)(H2,94,119)(H2,95,120)(H,96,132)(H,97,133)(H,98,134)(H,99,124)(H,100,121)(H,101,122)(H,102,125)(H,103,135)(H,104,128)(H,105,136)(H,106,117)(H,107,123)(H,108,126)(H,109,127)(H,110,129)(H,111,131)(H,112,130)(H,113,137)/t50-,51+,54-,55-,56-,57-,58-,59-,60-,65+,66-/m0/s1 |
| InChI Key | YPZSDWIWYLTCKG-PXROJGARSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C92H151N23O24 |
| Molecular Weight | 1963.30 g/mol |
| Exact Mass | 1962.13023278 g/mol |
| Topological Polar Surface Area (TPSA) | 714.00 Ų |
| XlogP | -2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.97% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.47% | 96.61% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.68% | 98.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 97.37% | 94.45% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 96.71% | 95.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.41% | 93.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.37% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.23% | 90.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.95% | 97.14% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.90% | 97.64% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 94.53% | 96.03% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 94.08% | 98.24% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 94.07% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.42% | 91.19% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.40% | 93.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.77% | 100.00% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 92.13% | 93.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.05% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.05% | 82.69% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.98% | 97.23% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 90.90% | 98.94% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.70% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.55% | 96.47% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.86% | 95.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.18% | 99.17% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 88.32% | 86.67% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 87.21% | 88.42% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.17% | 95.56% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 86.17% | 83.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.77% | 94.45% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 85.75% | 92.80% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.63% | 95.89% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.40% | 96.67% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.76% | 95.89% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 84.74% | 97.43% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.69% | 98.75% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.39% | 83.10% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 84.30% | 81.29% |
| CHEMBL5028 | O14672 | ADAM10 | 84.09% | 97.50% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.08% | 97.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.86% | 96.00% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 83.37% | 89.33% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.91% | 95.38% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.51% | 97.21% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 81.78% | 96.67% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.93% | 95.83% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.29% | 95.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.20% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163064632 |
| LOTUS | LTS0093202 |
| wikiData | Q105352095 |