Abyssinoflavanone V
| Internal ID | 24b5f116-1793-4dc3-885a-f28b18722ff4 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 2-prenylated flavans > 2-prenylated flavanones |
| IUPAC Name | (2S)-2-[(3S)-3,8-dihydroxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | CC(=CCC1=C(C=C2CC(C(OC2=C1O)(C)C)O)C3CC(=O)C4=C(C=C(C=C4O3)O)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C=C2C[C@@H](C(OC2=C1O)(C)C)O)[C@@H]3CC(=O)C4=C(C=C(C=C4O3)O)O)C |
| InChI | InChI=1S/C25H28O7/c1-12(2)5-6-15-16(7-13-8-21(29)25(3,4)32-24(13)23(15)30)19-11-18(28)22-17(27)9-14(26)10-20(22)31-19/h5,7,9-10,19,21,26-27,29-30H,6,8,11H2,1-4H3/t19-,21-/m0/s1 |
| InChI Key | PKRYDKCBXWCSAM-FPOVZHCZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 116.00 Ų |
| XlogP | 4.30 |
| 5,7,3'-Trihydroxy-2'-prenyl-(5''-hydroxy-6'',6''-dimethyldihydropyrano[2'',3'':4',5'])flavanone |
| LMPK12140430 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.50% | 94.45% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 94.09% | 96.12% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.06% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.95% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.39% | 85.14% |
| CHEMBL236 | P41143 | Delta opioid receptor | 91.02% | 99.35% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.73% | 89.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.65% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.18% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.99% | 94.73% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.04% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.92% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.59% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.73% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.40% | 90.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.38% | 93.40% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 84.53% | 80.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 83.65% | 97.93% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.19% | 92.68% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.91% | 99.17% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.39% | 91.07% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.40% | 97.09% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.33% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina abyssinica |
| PubChem | 10741771 |
| LOTUS | LTS0252131 |
| wikiData | Q105210592 |