5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one
Internal ID | a7ab9380-f4f7-44a7-a0a3-3c962bb4ee04 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O |
InChI | InChI=1S/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15+,17-,18-,21-/m0/s1 |
InChI Key | SOSLMHZOJATCCP-PVFUPILZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O10 |
Molecular Weight | 432.40 g/mol |
Exact Mass | 432.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
![2D Structure of 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one 2D Structure of 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/abcee4d0-866a-11ee-9416-bfb9028fa794.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.74% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.81% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 97.15% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.15% | 91.49% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.96% | 95.64% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.21% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.73% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.01% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.52% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 87.79% | 90.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.96% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.13% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.98% | 95.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.56% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.33% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.28% | 99.23% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 81.97% | 98.35% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.04% | 93.65% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.60% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fraxinus insularis |
PubChem | 162899764 |
LOTUS | LTS0042377 |
wikiData | Q105257154 |