2-[[6-[2-[1-[3-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-5-hydroxy-4-methoxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 4539ee0c-4a48-451f-9dd4-2ce625b41641 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-[[6-[2-[1-[3-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-5-hydroxy-4-methoxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3CCC4(C5CCC6(C(C5CC=C4C3)CC(C6C(C)OC7C(C(C(C(O7)C)O)OC)OC8C(C(C(C(O8)COC9C(C(C(C(O9)CO)O)O)O)O)O)O)O)C)C)C)O)OC)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3CCC4(C5CCC6(C(C5CC=C4C3)CC(C6C(C)OC7C(C(C(C(O7)C)O)OC)OC8C(C(C(C(O8)COC9C(C(C(C(O9)CO)O)O)O)O)O)O)O)C)C)C)O)OC)O |
InChI | InChI=1S/C54H90O24/c1-21(71-52-48(47(68-9)37(58)23(3)73-52)78-50-43(64)41(62)39(60)33(76-50)20-69-49-42(63)40(61)38(59)32(19-55)75-49)35-30(56)17-29-27-11-10-25-16-26(12-14-53(25,5)28(27)13-15-54(29,35)6)74-34-18-31(66-7)45(24(4)70-34)77-51-44(65)46(67-8)36(57)22(2)72-51/h10,21-24,26-52,55-65H,11-20H2,1-9H3 |
InChI Key | CHIRAQOIZROZGK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H90O24 |
Molecular Weight | 1123.30 g/mol |
Exact Mass | 1122.58220373 g/mol |
Topological Polar Surface Area (TPSA) | 343.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of 2-[[6-[2-[1-[3-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-5-hydroxy-4-methoxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of 2-[[6-[2-[1-[3-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-5-hydroxy-4-methoxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/aba50ea0-863f-11ee-967a-71121edbe2f3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.46% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.77% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.59% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.05% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 93.85% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.69% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.40% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.37% | 94.75% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.91% | 95.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.86% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.81% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.73% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.85% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.51% | 94.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.55% | 96.43% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.41% | 86.33% |
CHEMBL4072 | P07858 | Cathepsin B | 85.01% | 93.67% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.43% | 94.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.15% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.67% | 97.50% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.79% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.08% | 93.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.04% | 93.04% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.30% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca graeca |
Periploca sepium |
PubChem | 73015472 |
LOTUS | LTS0073483 |
wikiData | Q104958856 |