3-[(2R,3R)-3-carboxy-2-hydroxybutyl]-1-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxynaphthalene-2-carboxylic acid
Internal ID | bffe746f-8d77-4226-a909-7468fa981d0f |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 3-[(2R,3R)-3-carboxy-2-hydroxybutyl]-1-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxynaphthalene-2-carboxylic acid |
SMILES (Canonical) | CC(C(CC1=C(C2=CC=CC=C2C(=C1C(=O)O)O)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O)C(=O)O |
SMILES (Isomeric) | C[C@H]([C@@H](CC1=C(C2=CC=CC=C2C(=C1C(=O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O)O)C(=O)O |
InChI | InChI=1S/C28H36O17/c1-9(25(38)39)13(30)6-12-16(26(40)41)17(31)10-4-2-3-5-11(10)24(12)45-28-23(37)21(35)19(33)15(44-28)8-42-27-22(36)20(34)18(32)14(7-29)43-27/h2-5,9,13-15,18-23,27-37H,6-8H2,1H3,(H,38,39)(H,40,41)/t9-,13-,14-,15-,18-,19-,20+,21+,22-,23-,27-,28+/m1/s1 |
InChI Key | WZGSXPQLFKLLAL-IDHDNXBFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H36O17 |
Molecular Weight | 644.60 g/mol |
Exact Mass | 644.19524968 g/mol |
Topological Polar Surface Area (TPSA) | 294.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
![2D Structure of 3-[(2R,3R)-3-carboxy-2-hydroxybutyl]-1-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxynaphthalene-2-carboxylic acid 2D Structure of 3-[(2R,3R)-3-carboxy-2-hydroxybutyl]-1-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxynaphthalene-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/ab8edf70-8534-11ee-8733-4ff51c63fc0d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.41% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.44% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.26% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.37% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.46% | 94.73% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 91.43% | 94.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.86% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.00% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.79% | 96.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.70% | 94.62% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.97% | 93.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.05% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.81% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.52% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.53% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.04% | 99.23% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.84% | 94.08% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.86% | 96.37% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rubia yunnanensis |
PubChem | 163020126 |
LOTUS | LTS0199075 |
wikiData | Q105323139 |