[6-Benzamido-15-[1-(dimethylamino)ethyl]-5-hydroxy-7,7,12,16-tetramethyl-19-oxapentacyclo[9.8.0.01,18.03,8.012,16]nonadec-3-en-9-yl] acetate
Internal ID | 61127208-6554-4729-a93f-ab21cab5cfb8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | [6-benzamido-15-[1-(dimethylamino)ethyl]-5-hydroxy-7,7,12,16-tetramethyl-19-oxapentacyclo[9.8.0.01,18.03,8.012,16]nonadec-3-en-9-yl] acetate |
SMILES (Canonical) | CC(C1CCC2(C1(CC3C4(C2CC(C5C(=CC(C(C5(C)C)NC(=O)C6=CC=CC=C6)O)C4)OC(=O)C)O3)C)C)N(C)C |
SMILES (Isomeric) | CC(C1CCC2(C1(CC3C4(C2CC(C5C(=CC(C(C5(C)C)NC(=O)C6=CC=CC=C6)O)C4)OC(=O)C)O3)C)C)N(C)C |
InChI | InChI=1S/C35H50N2O5/c1-20(37(7)8)24-14-15-33(5)27-17-26(41-21(2)38)29-23(18-35(27)28(42-35)19-34(24,33)6)16-25(39)30(32(29,3)4)36-31(40)22-12-10-9-11-13-22/h9-13,16,20,24-30,39H,14-15,17-19H2,1-8H3,(H,36,40) |
InChI Key | JMNDJFQMPPGUNI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H50N2O5 |
Molecular Weight | 578.80 g/mol |
Exact Mass | 578.37197270 g/mol |
Topological Polar Surface Area (TPSA) | 91.40 Ų |
XlogP | 4.90 |
There are no found synonyms. |
![2D Structure of [6-Benzamido-15-[1-(dimethylamino)ethyl]-5-hydroxy-7,7,12,16-tetramethyl-19-oxapentacyclo[9.8.0.01,18.03,8.012,16]nonadec-3-en-9-yl] acetate 2D Structure of [6-Benzamido-15-[1-(dimethylamino)ethyl]-5-hydroxy-7,7,12,16-tetramethyl-19-oxapentacyclo[9.8.0.01,18.03,8.012,16]nonadec-3-en-9-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ab751ba0-843b-11ee-8ac5-3d6e58910018.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.33% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.01% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.96% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.28% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.17% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 90.58% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 90.11% | 97.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.86% | 94.62% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 89.59% | 89.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.19% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.59% | 99.23% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.11% | 81.11% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 87.23% | 94.23% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.05% | 94.08% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.43% | 91.07% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.09% | 93.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.89% | 93.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.97% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.74% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.36% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.32% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buxus papillosa |
Buxus sempervirens |
PubChem | 75071991 |
LOTUS | LTS0127065 |
wikiData | Q104888898 |