(1S,4S,12R,13R,14S,16S,17R)-17-hydroxy-17-(hydroxymethyl)-12-methyl-14-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6-dien-10-one
Internal ID | 694986f0-0bb6-4969-8608-b8e2d5f593d0 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | (1S,4S,12R,13R,14S,16S,17R)-17-hydroxy-17-(hydroxymethyl)-12-methyl-14-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6-dien-10-one |
SMILES (Canonical) | CC12CC(=O)C3=C(C1CCC45C2C(CC(C4)C(C5)(CO)O)OC6C(C(C(C(O6)CO)O)O)O)C=CO3 |
SMILES (Isomeric) | C[C@@]12CC(=O)C3=C([C@H]1CC[C@]45[C@H]2[C@H](C[C@H](C4)[C@](C5)(CO)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C=CO3 |
InChI | InChI=1S/C26H36O10/c1-24-8-15(29)21-13(3-5-34-21)14(24)2-4-25-7-12(26(33,10-25)11-28)6-16(22(24)25)35-23-20(32)19(31)18(30)17(9-27)36-23/h3,5,12,14,16-20,22-23,27-28,30-33H,2,4,6-11H2,1H3/t12-,14-,16+,17-,18-,19+,20-,22+,23-,24-,25+,26+/m1/s1 |
InChI Key | FNIBRRHOZLASGI-MYSLEATPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H36O10 |
Molecular Weight | 508.60 g/mol |
Exact Mass | 508.23084734 g/mol |
Topological Polar Surface Area (TPSA) | 170.00 Ų |
XlogP | -0.10 |
There are no found synonyms. |
![2D Structure of (1S,4S,12R,13R,14S,16S,17R)-17-hydroxy-17-(hydroxymethyl)-12-methyl-14-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6-dien-10-one 2D Structure of (1S,4S,12R,13R,14S,16S,17R)-17-hydroxy-17-(hydroxymethyl)-12-methyl-14-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6-dien-10-one](https://plantaedb.com/storage/docs/compounds/2023/11/ab273070-8748-11ee-9156-df6f8d281456.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.48% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.44% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.10% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.73% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.31% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.79% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.02% | 97.25% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.90% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.53% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.39% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.35% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.95% | 85.14% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.52% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.13% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.36% | 92.62% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.42% | 96.21% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.28% | 95.83% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.14% | 97.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.86% | 91.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.83% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.82% | 95.56% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.44% | 92.88% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.08% | 94.23% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.81% | 86.92% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.76% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.52% | 97.14% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.00% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coffea pseudozanguebariae |
PubChem | 162986112 |
LOTUS | LTS0236570 |
wikiData | Q104998309 |