methyl 2-[(2'S,4aS,8S,8aS)-7-(acetyloxymethyl)-2',4,4,8a-tetramethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetate
Internal ID | 55cc3836-fff7-4fd4-ad11-3d01e107e316 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | methyl 2-[(2'S,4aS,8S,8aS)-7-(acetyloxymethyl)-2',4,4,8a-tetramethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetate |
SMILES (Canonical) | CC(=O)OCC1=CCC2C(CCCC2(C13CCC(O3)(C)CC(=O)OC)C)(C)C |
SMILES (Isomeric) | CC(=O)OCC1=CC[C@@H]2[C@@]([C@@]13CC[C@@](O3)(C)CC(=O)OC)(CCCC2(C)C)C |
InChI | InChI=1S/C23H36O5/c1-16(24)27-15-17-8-9-18-20(2,3)10-7-11-22(18,5)23(17)13-12-21(4,28-23)14-19(25)26-6/h8,18H,7,9-15H2,1-6H3/t18-,21-,22-,23+/m0/s1 |
InChI Key | WQJABVVGZPWTBS-FDTGPBLFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H36O5 |
Molecular Weight | 392.50 g/mol |
Exact Mass | 392.25627424 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 3.70 |
There are no found synonyms. |
![2D Structure of methyl 2-[(2'S,4aS,8S,8aS)-7-(acetyloxymethyl)-2',4,4,8a-tetramethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetate 2D Structure of methyl 2-[(2'S,4aS,8S,8aS)-7-(acetyloxymethyl)-2',4,4,8a-tetramethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ab051df0-84f2-11ee-b0b3-4ffb38050223.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.70% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.19% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.81% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.56% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.11% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.44% | 85.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.07% | 91.19% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 85.68% | 91.65% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.21% | 91.07% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.70% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.56% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.77% | 92.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.57% | 96.95% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.40% | 95.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.81% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.06% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chrysoma pauciflosculosa |
Grindelia hirsutula |
PubChem | 163023399 |
LOTUS | LTS0081228 |
wikiData | Q105310750 |