8,9-Dimethoxy-4H-benzo(de)(1,6)naphthyridine
| Internal ID | c663d5e4-8111-40d6-bde6-62e71ce63296 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Naphthyridines |
| IUPAC Name | 11,12-dimethoxy-2,6-diazatricyclo[7.3.1.05,13]trideca-1,3,5(13),7,9,11-hexaene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H12N2O2/c1-16-10-7-8-3-5-14-9-4-6-15-12(11(8)9)13(10)17-2/h3-7,14H,1-2H3 |
| InChI Key | UERYGOYPBXIFQV-UHFFFAOYSA-N |
| Popularity | 24 references in papers |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.089877630 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 2.30 |
| 85547-22-4 |
| 8,9-dimethoxy-1H-benzo[de][1,6]naphthyridine |
| 1H-Benzo(de)(1,6)naphthyridine, 8,9-dimethoxy- |
| 8,9-Dimethoxy-1H-benzo(de)(1,6)naphthyridine |
| FGW9D01COE |
| 11,12-dimethoxy-2,6-diazatricyclo[7.3.1.05,13]trideca-1,3,5(13),7,9,11-hexaene |
| 1H-benzo[de][1,6]naphthyridine, 8,9-dimethoxy- |
| UNII-FGW9D01COE |
| BRN 3550089 |
| 8,9-dimethoxy-4h-benzo[de][1,6]naphthyridine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.79% | 94.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 95.08% | 95.12% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.89% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.32% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.42% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.73% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.40% | 93.99% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.99% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.26% | 94.45% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 88.20% | 85.49% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.79% | 89.44% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.26% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.46% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.10% | 96.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.75% | 94.03% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.29% | 92.98% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.28% | 89.62% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 82.59% | 81.14% |
| CHEMBL4158 | P49327 | Fatty acid synthase | 82.53% | 82.50% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.72% | 96.47% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.04% | 92.97% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.91% | 95.78% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.69% | 96.39% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.39% | 99.17% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.18% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 122826 |
| LOTUS | LTS0230235 |
| wikiData | Q104392762 |