[2-[2,6-Dihydroxy-3-[2-[3-hydroxy-2-[7-hydroxy-5-methyl-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-yl]-5-methylphenyl]acetyl]-4-methylphenyl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
| Internal ID | 4c20e6e1-129c-463f-81f2-f6f6db4ca674 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes > Stilbene glycosides |
| IUPAC Name | [2-[2,6-dihydroxy-3-[2-[3-hydroxy-2-[7-hydroxy-5-methyl-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-yl]-5-methylphenyl]acetyl]-4-methylphenyl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC1=CC(=C(C(=C1)O)C2=CC(=O)C3=C(O2)C(=C(C=C3C)O)C4C(C(C(C(O4)CO)O)O)O)CC(=O)C5=C(C(=C(C=C5C)O)C6C(C(C(C(O6)CO)O)O)OC(=O)C=CC7=CC=C(C=C7)O)O |
| SMILES (Isomeric) | CC1=CC(=C(C(=C1)O)C2=CC(=O)C3=C(O2)C(=C(C=C3C)O)C4C(C(C(C(O4)CO)O)O)O)CC(=O)C5=C(C(=C(C=C5C)O)C6C(C(C(C(O6)CO)O)O)OC(=O)C=CC7=CC=C(C=C7)O)O |
| InChI | InChI=1S/C47H48O19/c1-18-10-22(35(24(51)11-18)29-15-28(55)34-20(3)13-26(53)37(44(34)63-29)45-43(62)41(60)38(57)30(16-48)64-45)14-27(54)33-19(2)12-25(52)36(40(33)59)46-47(42(61)39(58)31(17-49)65-46)66-32(56)9-6-21-4-7-23(50)8-5-21/h4-13,15,30-31,38-39,41-43,45-53,57-62H,14,16-17H2,1-3H3 |
| InChI Key | FVTSPEQYMATRLK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C47H48O19 |
| Molecular Weight | 916.90 g/mol |
| Exact Mass | 916.27897930 g/mol |
| Topological Polar Surface Area (TPSA) | 331.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.83% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.96% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.64% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.16% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.05% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.27% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 92.71% | 90.71% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.52% | 83.82% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.94% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.86% | 99.15% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.72% | 96.95% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.99% | 91.71% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.82% | 96.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.63% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.49% | 99.17% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.49% | 90.93% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.30% | 90.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.33% | 91.07% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.47% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.43% | 94.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.90% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aloe ferox |
| PubChem | 163079884 |
| LOTUS | LTS0224268 |
| wikiData | Q105002735 |