(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-8-methoxy-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid
Internal ID | 82c35d73-b5d8-4aa2-b7c2-1afd7594f994 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-8-methoxy-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=C(C=C3)O)O)OC4C(C(C(C(O4)C(=O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=C(C=C3)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O |
InChI | InChI=1S/C22H20O12/c1-31-18-13(33-22-17(28)15(26)16(27)20(34-22)21(29)30)7-11(25)14-10(24)6-12(32-19(14)18)8-2-4-9(23)5-3-8/h2-7,15-17,20,22-23,25-28H,1H3,(H,29,30)/t15-,16-,17+,20-,22+/m0/s1 |
InChI Key | DUSDLJYRELRHJJ-NTKSAMNMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H20O12 |
Molecular Weight | 476.40 g/mol |
Exact Mass | 476.09547607 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.99% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.53% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 94.76% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.20% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.96% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.85% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 92.82% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.52% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.83% | 99.15% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.65% | 91.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.46% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.44% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.85% | 94.45% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 84.46% | 89.23% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.38% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.23% | 91.19% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.17% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.76% | 95.50% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.04% | 95.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.47% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erigeron canadensis |
PubChem | 162867687 |
LOTUS | LTS0132366 |
wikiData | Q104989390 |