21-Hydroxy-4,6,8,10,12-pentamethyl-15-oxa-22-azaheptacyclo[12.9.3.216,19.11,21.04,25.07,26.08,13]nonacosa-5,16,18,28-tetraene-23,24-dione
| Internal ID | 72384077-d3f6-4f3c-8520-a81d2a9f9be0 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
| IUPAC Name | 21-hydroxy-4,6,8,10,12-pentamethyl-15-oxa-22-azaheptacyclo[12.9.3.216,19.11,21.04,25.07,26.08,13]nonacosa-5,16,18,28-tetraene-23,24-dione |
| SMILES (Canonical) | CC1CC(C2C3C4C(C2(C1)C)C(=CC5(C4C(=O)C6(CC5)CC(CC7=CC=C(O3)C=C7)(NC6=O)O)C)C)C |
| SMILES (Isomeric) | CC1CC(C2C3C4C(C2(C1)C)C(=CC5(C4C(=O)C6(CC5)CC(CC7=CC=C(O3)C=C7)(NC6=O)O)C)C)C |
| InChI | InChI=1S/C32H41NO4/c1-17-12-18(2)24-26-22-23(30(24,5)13-17)19(3)14-29(4)10-11-31(27(34)25(22)29)16-32(36,33-28(31)35)15-20-6-8-21(37-26)9-7-20/h6-9,14,17-18,22-26,36H,10-13,15-16H2,1-5H3,(H,33,35) |
| InChI Key | KUCKCYNGDOWGEV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H41NO4 |
| Molecular Weight | 503.70 g/mol |
| Exact Mass | 503.30355879 g/mol |
| Topological Polar Surface Area (TPSA) | 75.60 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.25% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.38% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.79% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.18% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.72% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.39% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.90% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.68% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.65% | 96.09% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 87.53% | 91.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.82% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.27% | 93.40% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.05% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.44% | 86.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.78% | 97.79% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.48% | 98.03% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.37% | 94.80% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.38% | 86.00% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 81.46% | 96.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.90% | 88.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.78% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162984091 |
| LOTUS | LTS0197156 |
| wikiData | Q105146079 |