[(3aR,4R,5aS,6S,8R,8aS,9R,9aS)-9-acetyloxy-4,8-dihydroxy-8a-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] (Z)-2-methylbut-2-enoate
Internal ID | c7cb095a-2dba-4d0b-b98e-2619f745bbc6 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
IUPAC Name | [(3aR,4R,5aS,6S,8R,8aS,9R,9aS)-9-acetyloxy-4,8-dihydroxy-8a-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C2(C1CC(C3C(C2OC(=O)C)C(=C)C(=O)O3)O)C)O |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1C[C@H]([C@@]2([C@@H]1C[C@H]([C@H]3[C@H]([C@H]2OC(=O)C)C(=C)C(=O)O3)O)C)O |
InChI | InChI=1S/C21H28O8/c1-6-9(2)19(25)28-14-8-15(24)21(5)12(14)7-13(23)17-16(10(3)20(26)29-17)18(21)27-11(4)22/h6,12-18,23-24H,3,7-8H2,1-2,4-5H3/b9-6-/t12-,13-,14+,15-,16-,17+,18-,21+/m1/s1 |
InChI Key | KFWOFWGINGAOHD-KVDNEKLWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H28O8 |
Molecular Weight | 408.40 g/mol |
Exact Mass | 408.17841785 g/mol |
Topological Polar Surface Area (TPSA) | 119.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.47% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.04% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.87% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.48% | 99.23% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.20% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.45% | 86.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.44% | 97.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.22% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.12% | 91.07% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.13% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.03% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.22% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.99% | 97.25% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.99% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.99% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.72% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.72% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gaillardia pulchella |
PubChem | 162895752 |
LOTUS | LTS0060704 |
wikiData | Q105140588 |