(8S,15R,19S)-15-ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-triene-9,10,18-trione
| Internal ID | b90813fa-cc86-4b52-92dc-ee2ac9f25a98 |
| Taxonomy | Alkaloids and derivatives > Rhazinilam alkaloids |
| IUPAC Name | (8S,15R,19S)-15-ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-triene-9,10,18-trione |
| SMILES (Canonical) | CCC12CCCN3C14C(C5=CC=CC=C5N4C(=O)CC2)C(=O)C3=O |
| SMILES (Isomeric) | CC[C@]12CCCN3[C@]14[C@H](C5=CC=CC=C5N4C(=O)CC2)C(=O)C3=O |
| InChI | InChI=1S/C19H20N2O3/c1-2-18-9-5-11-20-17(24)16(23)15-12-6-3-4-7-13(12)21(19(15,18)20)14(22)8-10-18/h3-4,6-7,15H,2,5,8-11H2,1H3/t15-,18-,19+/m1/s1 |
| InChI Key | YGHNHIQMRLVAJP-LZQZEXGQSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14739250 g/mol |
| Topological Polar Surface Area (TPSA) | 57.70 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.75% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.44% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.24% | 93.40% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.55% | 89.63% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.63% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.25% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.00% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.98% | 93.99% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 89.65% | 90.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.41% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.17% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.26% | 82.69% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.25% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Kopsia griffithii |
| PubChem | 132937144 |
| LOTUS | LTS0038944 |
| wikiData | Q105348091 |