3-Bromo-2-hydroxy-6-[2-(2-methoxy-2-oxoethyl)-2-methyl-5-propan-2-ylcyclopentyl]-4-methylbenzoic acid
| Internal ID | 170d5c9d-f32c-4ef9-8b26-12b96bef15fc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Iridoids and derivatives |
| IUPAC Name | 3-bromo-2-hydroxy-6-[2-(2-methoxy-2-oxoethyl)-2-methyl-5-propan-2-ylcyclopentyl]-4-methylbenzoic acid |
| SMILES (Canonical) | CC1=CC(=C(C(=C1Br)O)C(=O)O)C2C(CCC2(C)CC(=O)OC)C(C)C |
| SMILES (Isomeric) | CC1=CC(=C(C(=C1Br)O)C(=O)O)C2C(CCC2(C)CC(=O)OC)C(C)C |
| InChI | InChI=1S/C20H27BrO5/c1-10(2)12-6-7-20(4,9-14(22)26-5)16(12)13-8-11(3)17(21)18(23)15(13)19(24)25/h8,10,12,16,23H,6-7,9H2,1-5H3,(H,24,25) |
| InChI Key | PFHVKHJUCDAVBU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H27BrO5 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.10419 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.92% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 95.09% | 95.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.53% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.30% | 96.38% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.02% | 93.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.12% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.73% | 99.15% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.59% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.80% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.95% | 90.71% |
| CHEMBL5028 | O14672 | ADAM10 | 83.64% | 97.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.95% | 92.62% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.66% | 90.24% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.30% | 91.07% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.74% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.24% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.99% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162860999 |
| LOTUS | LTS0077390 |
| wikiData | Q104194579 |