(3S,8R,9S,10R,14S,16S,17S)-17-[(1S)-1-[(2S,5S)-5-(hydroxymethyl)piperidin-2-yl]ethyl]-10,17-dimethyl-2,3,4,7,8,9,11,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol
| Internal ID | 825979c0-e589-48db-96e0-138c43bc2b55 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Hydroxysteroids > 3-hydroxysteroids > 3-beta-hydroxysteroids |
| IUPAC Name | (3S,8R,9S,10R,14S,16S,17S)-17-[(1S)-1-[(2S,5S)-5-(hydroxymethyl)piperidin-2-yl]ethyl]-10,17-dimethyl-2,3,4,7,8,9,11,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES (Canonical) | CC(C1CCC(CN1)CO)C2(C(CC3C2=CCC4C3CC=C5C4(CCC(C5)O)C)O)C |
| SMILES (Isomeric) | C[C@H]([C@@H]1CC[C@@H](CN1)CO)[C@@]2([C@H](C[C@@H]3C2=CC[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O)C)O)C |
| InChI | InChI=1S/C27H43NO3/c1-16(24-9-4-17(15-29)14-28-24)27(3)23-8-7-22-20(21(23)13-25(27)31)6-5-18-12-19(30)10-11-26(18,22)2/h5,8,16-17,19-22,24-25,28-31H,4,6-7,9-15H2,1-3H3/t16-,17+,19+,20+,21+,22+,24+,25+,26+,27+/m1/s1 |
| InChI Key | GCDHTUKGDAYFNZ-QDFFDVMASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.32429423 g/mol |
| Topological Polar Surface Area (TPSA) | 72.70 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.33% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.85% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.38% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.49% | 95.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.42% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.70% | 94.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.46% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.43% | 100.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.53% | 97.79% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.50% | 96.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.45% | 85.14% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.97% | 89.05% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.48% | 91.03% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.82% | 95.89% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.72% | 98.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.91% | 91.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.37% | 90.71% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 83.14% | 95.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.72% | 98.10% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.81% | 82.69% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.04% | 93.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.88% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.76% | 95.56% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.25% | 96.03% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.11% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162860710 |
| LOTUS | LTS0079583 |
| wikiData | Q105006208 |