(2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-[(1R,6R)-3-(4-methylpent-3-enyl)-6-phenylcyclohex-3-en-1-yl]methanone
| Internal ID | b8ff3928-9056-4f34-916b-fd29b49713a9 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | (2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-[(1R,6R)-3-(4-methylpent-3-enyl)-6-phenylcyclohex-3-en-1-yl]methanone |
| SMILES (Canonical) | CC1=C(C(=C(C(=C1O)C(=O)C2CC(=CCC2C3=CC=CC=C3)CCC=C(C)C)OC)C)O |
| SMILES (Isomeric) | CC1=C(C(=C(C(=C1O)C(=O)[C@@H]2CC(=CC[C@H]2C3=CC=CC=C3)CCC=C(C)C)OC)C)O |
| InChI | InChI=1S/C28H34O4/c1-17(2)10-9-11-20-14-15-22(21-12-7-6-8-13-21)23(16-20)27(31)24-26(30)18(3)25(29)19(4)28(24)32-5/h6-8,10,12-14,22-23,29-30H,9,11,15-16H2,1-5H3/t22-,23+/m0/s1 |
| InChI Key | XNIZQTNFDVHYAF-XZOQPEGZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 6.80 |
| There are no found synonyms. |
![2D Structure of (2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-[(1R,6R)-3-(4-methylpent-3-enyl)-6-phenylcyclohex-3-en-1-yl]methanone](https://plantaedb.com/storage/docs/compounds/2023/11/a8bf56f0-855e-11ee-913e-01d731994cb0.jpg "2D Structure of (2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-[(1R,6R)-3-(4-methylpent-3-enyl)-6-phenylcyclohex-3-en-1-yl]methanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.21% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.13% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.84% | 96.09% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.61% | 94.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.36% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.16% | 97.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.97% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.15% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.77% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.32% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Drepananthus carinatus |
| PubChem | 11797107 |
| LOTUS | LTS0110750 |
| wikiData | Q105331712 |