3-[(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one
Internal ID | 6bbd2855-3735-4524-95c1-183b1bb245c4 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)OC5C(C(C(C(O5)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O[C@@H]5[C@@H]([C@H]([C@@H]([C@@H](O5)CO)O)O)O)O)O |
InChI | InChI=1S/C27H30O16/c1-8-17(33)21(37)25(43-26-22(38)20(36)18(34)15(7-28)41-26)27(39-8)42-24-19(35)16-13(32)5-10(29)6-14(16)40-23(24)9-2-3-11(30)12(31)4-9/h2-6,8,15,17-18,20-22,25-34,36-38H,7H2,1H3/t8-,15-,17-,18+,20-,21-,22+,25-,26+,27-/m0/s1 |
InChI Key | DFNXNCCYQRPZMD-QPOOPYBHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O16 |
Molecular Weight | 610.50 g/mol |
Exact Mass | 610.15338487 g/mol |
Topological Polar Surface Area (TPSA) | 266.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.20% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.91% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 97.32% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.05% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.01% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.99% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.05% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.88% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.57% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.51% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.53% | 97.36% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.21% | 95.64% |
CHEMBL3194 | P02766 | Transthyretin | 84.38% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.92% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.18% | 90.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.90% | 95.78% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.77% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ginkgo biloba |
PubChem | 162951709 |
LOTUS | LTS0204003 |
wikiData | Q104978061 |