[(1R,4aS,5R,5'S,8aS)-5'-(2-methoxy-2-oxoethyl)-1,4a,5',6-tetramethylspiro[3,4,8,8a-tetrahydro-2H-naphthalene-5,2'-oxolane]-1-yl]methyl 2-methylpropanoate
Internal ID | 12168919-26ec-471f-9d32-a8a0906ad30a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [(1R,4aS,5R,5'S,8aS)-5'-(2-methoxy-2-oxoethyl)-1,4a,5',6-tetramethylspiro[3,4,8,8a-tetrahydro-2H-naphthalene-5,2'-oxolane]-1-yl]methyl 2-methylpropanoate |
SMILES (Canonical) | CC1=CCC2C(CCCC2(C13CCC(O3)(C)CC(=O)OC)C)(C)COC(=O)C(C)C |
SMILES (Isomeric) | CC1=CC[C@H]2[C@](CCC[C@@]2([C@@]13CC[C@@](O3)(C)CC(=O)OC)C)(C)COC(=O)C(C)C |
InChI | InChI=1S/C25H40O5/c1-17(2)21(27)29-16-22(4)11-8-12-24(6)19(22)10-9-18(3)25(24)14-13-23(5,30-25)15-20(26)28-7/h9,17,19H,8,10-16H2,1-7H3/t19-,22-,23-,24-,25+/m0/s1 |
InChI Key | XDWAWFACGNSUSS-FUBBUTDDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H40O5 |
Molecular Weight | 420.60 g/mol |
Exact Mass | 420.28757437 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 4.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.31% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.53% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.38% | 92.62% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 88.27% | 95.71% |
CHEMBL2581 | P07339 | Cathepsin D | 85.49% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.46% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.18% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.97% | 95.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.73% | 95.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.87% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.74% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.48% | 90.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.10% | 94.73% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.93% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 81.25% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.89% | 94.00% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.55% | 94.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.49% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Grindelia hirsutula |
PubChem | 162895968 |
LOTUS | LTS0042231 |
wikiData | Q105326095 |