(3,4,5-Trihydroxyoxan-2-yl) 10-[5-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4a-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylate
Internal ID | 51f321fd-0aae-4f36-b1e1-b08e8d2ee028 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (3,4,5-trihydroxyoxan-2-yl) 10-[5-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4a-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3COC(C(C3O)OC4C(C(C(C(O4)CO)O)O)O)OC5CCC6(C(C5(C)C)CCC7(C6CC=C8C7(CC(C9(C8CC(CC9)(C)C(=O)OC1C(C(C(CO1)O)O)O)CO)O)C)C)C)CO)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3COC(C(C3O)OC4C(C(C(C(O4)CO)O)O)O)OC5CCC6(C(C5(C)C)CCC7(C6CC=C8C7(CC(C9(C8CC(CC9)(C)C(=O)OC1C(C(C(CO1)O)O)O)CO)O)C)C)C)CO)O)O)O)O)O |
InChI | InChI=1S/C58H94O27/c1-23-34(64)39(69)43(73)48(78-23)84-46-41(71)37(67)28(19-60)80-51(46)81-29-21-77-50(45(38(29)68)83-49-44(74)40(70)36(66)27(18-59)79-49)82-33-11-12-55(5)30(53(33,2)3)10-13-56(6)31(55)9-8-24-25-16-54(4,14-15-58(25,22-61)32(63)17-57(24,56)7)52(75)85-47-42(72)35(65)26(62)20-76-47/h8,23,25-51,59-74H,9-22H2,1-7H3 |
InChI Key | JAYFZCJTSIZFNG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H94O27 |
Molecular Weight | 1223.30 g/mol |
Exact Mass | 1222.59824772 g/mol |
Topological Polar Surface Area (TPSA) | 433.00 Ų |
XlogP | -2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.24% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.68% | 97.36% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.18% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.23% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.72% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.97% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.77% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.09% | 96.77% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.80% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.43% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.91% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 85.75% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.58% | 86.33% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.31% | 89.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.94% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.05% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 82.50% | 97.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.50% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.33% | 97.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.24% | 94.75% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.08% | 92.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.48% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ardisia pusilla |
PubChem | 74437960 |
LOTUS | LTS0085071 |
wikiData | Q105124143 |