(2S,4S)-N-[(2S,4S,6S)-1-[[(2S,3R)-1-[[1-[[(2S)-1-[[(2S)-1-[[1-[[1-[[3-[[(2S)-1-(dimethylamino)propan-2-yl]amino]-3-oxopropyl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-hydroxy-4-methyl-1-oxopentan-2-yl]amino]-6-hydroxy-4-methyl-1,8-dioxodecan-2-yl]-4-methyl-1-[(E,4S)-4-methylhex-2-enoyl]pyrrolidine-2-carboxamide
| Internal ID | 9c2402e5-d3c8-4386-a218-bf760762a6f4 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S,4S)-N-[(2S,4S,6S)-1-[[(2S,3R)-1-[[1-[[(2S)-1-[[(2S)-1-[[1-[[1-[[3-[[(2S)-1-(dimethylamino)propan-2-yl]amino]-3-oxopropyl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-hydroxy-4-methyl-1-oxopentan-2-yl]amino]-6-hydroxy-4-methyl-1,8-dioxodecan-2-yl]-4-methyl-1-[(E,4S)-4-methylhex-2-enoyl]pyrrolidine-2-carboxamide |
| SMILES (Canonical) | CCC(C)C=CC(=O)N1CC(CC1C(=O)NC(CC(C)CC(CC(=O)CC)O)C(=O)NC(C(C(C)C)O)C(=O)NC(C)(C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NCCC(=O)NC(C)CN(C)C)C |
| SMILES (Isomeric) | CC[C@H](C)/C=C/C(=O)N1C[C@H](C[C@H]1C(=O)N[C@@H](C[C@H](C)C[C@@H](CC(=O)CC)O)C(=O)N[C@@H]([C@@H](C(C)C)O)C(=O)NC(C)(C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NCCC(=O)N[C@@H](C)CN(C)C)C |
| InChI | InChI=1S/C62H111N11O13/c1-21-38(9)23-24-49(77)73-33-40(11)31-47(73)55(82)66-46(30-39(10)29-43(75)32-42(74)22-2)53(80)68-50(51(78)37(7)8)56(83)70-61(15,16)58(85)67-44(27-35(3)4)52(79)65-45(28-36(5)6)54(81)69-62(17,18)59(86)71-60(13,14)57(84)63-26-25-48(76)64-41(12)34-72(19)20/h23-24,35-41,43-47,50-51,75,78H,21-22,25-34H2,1-20H3,(H,63,84)(H,64,76)(H,65,79)(H,66,82)(H,67,85)(H,68,80)(H,69,81)(H,70,83)(H,71,86)/b24-23+/t38-,39+,40-,41-,43-,44-,45-,46-,47-,50-,51+/m0/s1 |
| InChI Key | FOAIGCPESMNWQP-TXVCAPCZSA-N |
| Popularity | 39 references in papers |
| Molecular Formula | C62H111N11O13 |
| Molecular Weight | 1218.60 g/mol |
| Exact Mass | 1217.83628264 g/mol |
| Topological Polar Surface Area (TPSA) | 343.00 Ų |
| XlogP | 4.30 |
| Atomic LogP (AlogP) | 2.28 |
| H-Bond Acceptor | 14 |
| H-Bond Donor | 11 |
| Rotatable Bonds | 37 |
| 76600-38-9 |
| A20668 |
| CC 1014 |
| CHEMBL4638759 |
| DTXSID401345681 |
| AKOS040746673 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7359 | 73.59% |
| Caco-2 | - | 0.8615 | 86.15% |
| Blood Brain Barrier | - | 0.7000 | 70.00% |
| Human oral bioavailability | - | 0.7143 | 71.43% |
| Subcellular localzation | Mitochondria | 0.5175 | 51.75% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8245 | 82.45% |
| OATP1B3 inhibitior | + | 0.9007 | 90.07% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9480 | 94.80% |
| P-glycoprotein inhibitior | + | 0.7427 | 74.27% |
| P-glycoprotein substrate | + | 0.8621 | 86.21% |
| CYP3A4 substrate | + | 0.7494 | 74.94% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8239 | 82.39% |
| CYP3A4 inhibition | - | 0.8961 | 89.61% |
| CYP2C9 inhibition | - | 0.8766 | 87.66% |
| CYP2C19 inhibition | - | 0.8416 | 84.16% |
| CYP2D6 inhibition | - | 0.9096 | 90.96% |
| CYP1A2 inhibition | - | 0.8994 | 89.94% |
| CYP2C8 inhibition | + | 0.7079 | 70.79% |
| CYP inhibitory promiscuity | - | 0.9844 | 98.44% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.6151 | 61.51% |
| Eye corrosion | - | 0.9836 | 98.36% |
| Eye irritation | - | 0.8965 | 89.65% |
| Skin irritation | - | 0.7765 | 77.65% |
| Skin corrosion | - | 0.8632 | 86.32% |
| Ames mutagenesis | - | 0.6700 | 67.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6973 | 69.73% |
| Micronuclear | + | 0.6700 | 67.00% |
| Hepatotoxicity | + | 0.5677 | 56.77% |
| skin sensitisation | - | 0.8703 | 87.03% |
| Respiratory toxicity | + | 0.6444 | 64.44% |
| Reproductive toxicity | + | 0.7000 | 70.00% |
| Mitochondrial toxicity | + | 0.7000 | 70.00% |
| Nephrotoxicity | - | 0.7045 | 70.45% |
| Acute Oral Toxicity (c) | III | 0.6500 | 65.00% |
| Estrogen receptor binding | + | 0.6530 | 65.30% |
| Androgen receptor binding | + | 0.7241 | 72.41% |
| Thyroid receptor binding | + | 0.6306 | 63.06% |
| Glucocorticoid receptor binding | + | 0.7309 | 73.09% |
| Aromatase binding | + | 0.7241 | 72.41% |
| PPAR gamma | + | 0.8020 | 80.20% |
| Honey bee toxicity | - | 0.6662 | 66.62% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.5124 | 51.24% |
| Fish aquatic toxicity | - | 0.4042 | 40.42% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.92% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.86% | 98.95% |
| CHEMBL4801 | P29466 | Caspase-1 | 98.85% | 96.85% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.22% | 96.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.92% | 98.33% |
| CHEMBL4072 | P07858 | Cathepsin B | 97.50% | 93.67% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.35% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.92% | 93.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.41% | 90.17% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 96.11% | 98.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.01% | 98.05% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 95.88% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.41% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.30% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.41% | 90.71% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 94.27% | 95.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.15% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.84% | 96.47% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.66% | 97.14% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 92.63% | 98.94% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.59% | 97.21% |
| CHEMBL236 | P41143 | Delta opioid receptor | 92.32% | 99.35% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 92.26% | 97.50% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.04% | 90.08% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 91.80% | 98.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.64% | 91.19% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 91.52% | 97.29% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 91.05% | 98.59% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.60% | 85.31% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.57% | 97.29% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 90.34% | 97.50% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 90.26% | 95.52% |
| CHEMBL3468 | P55210 | Caspase-7 | 90.25% | 95.68% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.25% | 100.00% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 90.15% | 96.67% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.13% | 89.34% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.12% | 96.77% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.05% | 96.90% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 89.67% | 97.47% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.66% | 95.36% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 89.54% | 98.57% |
| CHEMBL3776 | Q14790 | Caspase-8 | 89.50% | 97.06% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 89.49% | 95.27% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.26% | 96.00% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 89.13% | 94.05% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 88.89% | 97.64% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.87% | 89.05% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.59% | 89.50% |
| CHEMBL228 | P31645 | Serotonin transporter | 87.79% | 95.51% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.62% | 95.93% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.30% | 92.86% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.07% | 89.00% |
| CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 86.73% | 81.88% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.65% | 97.79% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.26% | 91.11% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.95% | 85.11% |
| CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 | 85.81% | 93.85% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 85.26% | 99.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.89% | 99.23% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 84.75% | 92.12% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.70% | 93.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.46% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 83.44% | 97.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.35% | 100.00% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 82.88% | 98.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.88% | 94.33% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.42% | 98.03% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 81.92% | 96.33% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 81.68% | 96.67% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.60% | 91.24% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.43% | 96.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.17% | 97.09% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 80.65% | 92.80% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 80.53% | 92.38% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.16% | 96.37% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 156012899 |
| LOTUS | LTS0076050 |
| wikiData | Q104998639 |