(12-Hydroxy-4,9-dimethyl-13-methylidene-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-11-yl) 2-methylprop-2-enoate
Internal ID | d50c9ac5-07b9-4089-8529-114d1467399a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (12-hydroxy-4,9-dimethyl-13-methylidene-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-11-yl) 2-methylprop-2-enoate |
SMILES (Canonical) | CC(=C)C(=O)OC1CC2(C(O2)CCC3(C(O3)C4C1(C(=C)C(=O)O4)O)C)C |
SMILES (Isomeric) | CC(=C)C(=O)OC1CC2(C(O2)CCC3(C(O3)C4C1(C(=C)C(=O)O4)O)C)C |
InChI | InChI=1S/C19H24O7/c1-9(2)15(20)23-12-8-18(5)11(25-18)6-7-17(4)13(26-17)14-19(12,22)10(3)16(21)24-14/h11-14,22H,1,3,6-8H2,2,4-5H3 |
InChI Key | YQGDTKJBNXASAN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24O7 |
Molecular Weight | 364.40 g/mol |
Exact Mass | 364.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 97.90 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.63% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.55% | 96.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.92% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.97% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.40% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.17% | 85.14% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.66% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.83% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.49% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.90% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.22% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 82.11% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.36% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.26% | 97.09% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.76% | 97.28% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.65% | 92.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.50% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Montanoa tomentosa |
PubChem | 162957861 |
LOTUS | LTS0096824 |
wikiData | Q105352213 |