[6-(4-Hydroxyphenyl)-3-methyl-2-(3-methylbut-2-enyl)cyclohex-3-en-1-yl]-(2,4,6-trihydroxyphenyl)methanone
Internal ID | 9a7e0ce9-910a-496f-8788-2a122e75bc63 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | [6-(4-hydroxyphenyl)-3-methyl-2-(3-methylbut-2-enyl)cyclohex-3-en-1-yl]-(2,4,6-trihydroxyphenyl)methanone |
SMILES (Canonical) | CC1=CCC(C(C1CC=C(C)C)C(=O)C2=C(C=C(C=C2O)O)O)C3=CC=C(C=C3)O |
SMILES (Isomeric) | CC1=CCC(C(C1CC=C(C)C)C(=O)C2=C(C=C(C=C2O)O)O)C3=CC=C(C=C3)O |
InChI | InChI=1S/C25H28O5/c1-14(2)4-10-19-15(3)5-11-20(16-6-8-17(26)9-7-16)23(19)25(30)24-21(28)12-18(27)13-22(24)29/h4-9,12-13,19-20,23,26-29H,10-11H2,1-3H3 |
InChI Key | LTYUEHHTNMCSPR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O5 |
Molecular Weight | 408.50 g/mol |
Exact Mass | 408.19367399 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 5.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 95.86% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 95.03% | 97.21% |
CHEMBL2581 | P07339 | Cathepsin D | 92.95% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.68% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.64% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.31% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.69% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.03% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.01% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.45% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.30% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.88% | 85.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.19% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boesenbergia rotunda |
PubChem | 163049403 |
LOTUS | LTS0095797 |
wikiData | Q105157278 |