4-Chloro-3-ethenyl-2-isothiocyanato-3,7,7-trimethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),11,13-triene-9,16-dione
| Internal ID | 3d3ed789-52c8-45e3-9d65-c06ef85faf01 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolines |
| IUPAC Name | 4-chloro-3-ethenyl-2-isothiocyanato-3,7,7-trimethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),11,13-triene-9,16-dione |
| SMILES (Canonical) | CC1(C2CC(C(C(C2=O)(C3=C4C1C(=O)NC4=CC=C3)N=C=S)(C)C=C)Cl)C |
| SMILES (Isomeric) | CC1(C2CC(C(C(C2=O)(C3=C4C1C(=O)NC4=CC=C3)N=C=S)(C)C=C)Cl)C |
| InChI | InChI=1S/C21H21ClN2O2S/c1-5-20(4)14(22)9-12-17(25)21(20,23-10-27)11-7-6-8-13-15(11)16(18(26)24-13)19(12,2)3/h5-8,12,14,16H,1,9H2,2-4H3,(H,24,26) |
| InChI Key | VLJMTNLRJHJRGI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H21ClN2O2S |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.1012268 g/mol |
| Topological Polar Surface Area (TPSA) | 90.60 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.49% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.04% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.77% | 94.45% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.69% | 94.62% |
| CHEMBL240 | Q12809 | HERG | 91.54% | 89.76% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.22% | 97.09% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 91.13% | 96.42% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.03% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.22% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.90% | 98.95% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.87% | 93.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.54% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.13% | 93.40% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.37% | 95.89% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.19% | 94.08% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.02% | 90.00% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.68% | 94.23% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.55% | 88.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.52% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162976211 |
| LOTUS | LTS0084471 |
| wikiData | Q104199565 |