CID 21674228
| Internal ID | dcd792d2-1b59-4aff-aeb1-978cee3fbda3 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | [(2S,3aS,6R,7aS)-1-[(2R,3S)-2-[[(2R)-3-(3-chloro-4-hydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylpentanoyl]-2-[4-(diaminomethylideneamino)butylcarbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl] hydrogen sulfate |
| SMILES (Canonical) | CCC(C)C(C(=O)N1C2CC(CCC2CC1C(=O)NCCCCN=C(N)N)OS(=O)(=O)O)NC(=O)C(CC3=CC(=C(C=C3)O)Cl)O |
| SMILES (Isomeric) | CC[C@H](C)[C@H](C(=O)N1[C@H]2C[C@@H](CC[C@H]2C[C@H]1C(=O)NCCCCN=C(N)N)OS(=O)(=O)O)NC(=O)[C@@H](CC3=CC(=C(C=C3)O)Cl)O |
| InChI | InChI=1S/C29H45ClN6O9S/c1-3-16(2)25(35-27(40)24(38)13-17-6-9-23(37)20(30)12-17)28(41)36-21-15-19(45-46(42,43)44)8-7-18(21)14-22(36)26(39)33-10-4-5-11-34-29(31)32/h6,9,12,16,18-19,21-22,24-25,37-38H,3-5,7-8,10-11,13-15H2,1-2H3,(H,33,39)(H,35,40)(H4,31,32,34)(H,42,43,44)/t16-,18-,19+,21-,22-,24+,25+/m0/s1 |
| InChI Key | LNRXFFGKAKWQCV-VYYLBCPOSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C29H45ClN6O9S |
| Molecular Weight | 689.20 g/mol |
| Exact Mass | 688.2657259 g/mol |
| Topological Polar Surface Area (TPSA) | 255.00 Ų |
| XlogP | 1.20 |
| DTXSID601046483 |
| [(2S,3aS,6R,7aS)-1-[(2R,3S)-2-[[(2R)-3-(3-chloro-4-hydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylpentanoyl]-2-[4-(diaminomethylideneamino)butylcarbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl] hydrogen sulate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.72% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.50% | 96.09% |
| CHEMBL4072 | P07858 | Cathepsin B | 98.57% | 93.67% |
| CHEMBL204 | P00734 | Thrombin | 98.50% | 96.01% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.42% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.40% | 94.45% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 97.87% | 85.31% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.05% | 91.11% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 96.61% | 95.34% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 96.30% | 97.21% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 95.64% | 91.19% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.96% | 98.33% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 93.90% | 96.76% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.71% | 90.24% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.65% | 100.00% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 93.19% | 88.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.83% | 100.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 92.08% | 96.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.19% | 96.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.02% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.79% | 95.89% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 90.64% | 98.05% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.54% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.28% | 90.71% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.85% | 96.21% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.59% | 93.56% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 89.40% | 97.50% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 89.03% | 95.52% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.00% | 97.29% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.73% | 94.66% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.17% | 98.59% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.96% | 96.38% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.55% | 96.90% |
| CHEMBL5028 | O14672 | ADAM10 | 87.18% | 97.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.06% | 100.00% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 87.04% | 99.23% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 86.27% | 100.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.21% | 92.88% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.31% | 90.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.47% | 97.25% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.45% | 95.58% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.16% | 93.03% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.87% | 94.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.45% | 97.14% |
| CHEMBL3025 | P23280 | Carbonic anhydrase VI | 82.86% | 97.50% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 82.56% | 80.71% |
| CHEMBL238 | Q01959 | Dopamine transporter | 81.80% | 95.88% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.53% | 96.37% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 81.39% | 96.67% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 81.20% | 97.53% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 81.16% | 90.65% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.72% | 94.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.15% | 93.81% |
| CHEMBL4805 | Q99572 | P2X purinoceptor 7 | 80.05% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21674228 |
| LOTUS | LTS0127207 |
| wikiData | Q77490276 |